Difference between revisions of "L-LACTATE-DEHYDROGENASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCMP DCMP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP([O-])([O-])=O * inchi key: **...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6964 PWY-6964] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-11...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6964 PWY-6964] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2836 TAX-2836] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
* common name: | * common name: | ||
− | ** | + | ** ammonia assimilation cycle II |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** GS/GOGAT pathway |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''2''' reactions found over '''2''' reactions in the full pathway |
− | * [[ | + | * [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]] |
− | + | ** 3 associated gene(s): | |
− | * [[ | + | *** [[Ec-26_004630]] |
− | * [[RXN- | + | *** [[Ec-00_000720]] |
− | == Reaction(s) | + | *** [[Ec-27_004970]] |
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[GLUTAMINESYN-RXN]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Ec-15_004110]] | ||
+ | *** [[Ec-21_003610]] | ||
+ | *** [[Ec-09_000640]] | ||
+ | *** [[Ec-15_004120]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-1117}} | |
− | + | {{#set: taxonomic range=TAX-2836}} | |
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: common name=ammonia assimilation cycle II}} | |
− | + | {{#set: common name=GS/GOGAT pathway}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=2}} | |
− | + | {{#set: completion rate=100.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 22:25, 17 March 2018
Pathway PWY-6964
- taxonomic range:
- common name:
- ammonia assimilation cycle II
- Synonym(s):
- GS/GOGAT pathway
Reaction(s) found
2 reactions found over 2 reactions in the full pathway
- GLUTAMATE-SYNTHASE-FERREDOXIN-RXN
- 3 associated gene(s):
- 2 reconstruction source(s) associated:
- GLUTAMINESYN-RXN
- 4 associated gene(s):
- 2 reconstruction source(s) associated: