Difference between revisions of "2-ISOPROPYLMALATESYN-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11878 CPD-11878] == * smiles: ** C(O)C(O)C1(C=CC(O)=C(O)C=1) * inchi key: ** InChIKey=MTVWF...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Phosphatase-2A-leucine Phosphatase-2A-leucine] == * common name: ** a [phosphatase 2A protein]...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Phosphatase-2A-leucine Phosphatase-2A-leucine] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a [phosphatase 2A protein] C-terminal L-leucine |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** a C-terminal [phosphatase 2A protein]-leucine |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-12322]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a [phosphatase 2A protein] C-terminal L-leucine}} | |
− | + | {{#set: common name=a C-terminal [phosphatase 2A protein]-leucine}} | |
− | + | {{#set: produced by=RXN-12322}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | {{#set: produced by=RXN- | + |
Revision as of 22:25, 17 March 2018
Contents
Metabolite Phosphatase-2A-leucine
- common name:
- a [phosphatase 2A protein] C-terminal L-leucine
- Synonym(s):
- a C-terminal [phosphatase 2A protein]-leucine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a [phosphatase 2A protein] C-terminal L-leucine" cannot be used as a page name in this wiki.
"a C-terminal [phosphatase 2A protein]-leucine" cannot be used as a page name in this wiki.