Difference between revisions of "Ec-26 005690"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8620 CPD-8620] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6908 PWY-6908] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8620 CPD-8620] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33630 TAX-33630]
+
* inchi key:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
** InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N
 
* common name:
 
* common name:
−
** thiamine diphosphate biosynthesis IV (eukaryotes)
+
** 5α-cholesta-8-en-3-one
 +
* molecular weight:
 +
** 384.644   
 
* Synonym(s):
 
* Synonym(s):
−
** thiamin diphosphate biosynthesis IV (eukaryotes)
 
−
** vitamin B1 biosynthesis IV (eukaryotes)
 
−
** thiamine diphosphate biosynthesis (plants)
 
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''2''' reactions found over '''3''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[THI-P-SYN-RXN]]
+
* [[RXN66-23]]
−
* [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4191 RXNQT-4191]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-4751}}
+
* PUBCHEM:
−
{{#set: taxonomic range=TAX-33630}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203379 25203379]
−
{{#set: taxonomic range=TAX-33090}}
+
* HMDB : HMDB12178
−
{{#set: common name=thiamine diphosphate biosynthesis IV (eukaryotes)}}
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C}}
−
{{#set: common name=thiamin diphosphate biosynthesis IV (eukaryotes)|vitamin B1 biosynthesis IV (eukaryotes)|thiamine diphosphate biosynthesis (plants)}}
+
{{#set: inchi key=InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N}}
−
{{#set: reaction found=2}}
+
{{#set: common name=5α-cholesta-8-en-3-one}}
−
{{#set: reaction not found=3}}
+
{{#set: molecular weight=384.644    }}
−
{{#set: completion rate=67.0}}
+
{{#set: produced by=RXN66-23}}

Revision as of 21:26, 17 March 2018

Metabolite CPD-8620

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C
  • inchi key:
    • InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N
  • common name:
    • 5α-cholesta-8-en-3-one
  • molecular weight:
    • 384.644
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-26_005690&oldid=13019"