Difference between revisions of "Aryl-Alcohol"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-236 CPD-236] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Phosphatase-2A-leucine-methyl-ester Phosphatase-2A-leucine-methyl-ester] == * common name: ** a...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-236 CPD-236] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Phosphatase-2A-leucine-methyl-ester Phosphatase-2A-leucine-methyl-ester] ==
* smiles:
+
** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))
+
* inchi key:
+
** InChIKey=BKBYHSYZKIAJDA-LPEMZMRWSA-M
+
 
* common name:
 
* common name:
** gibberellin A29
+
** a [phosphatase 2A protein] C-terminal L-leucine methyl ester
* molecular weight:
+
** 347.387   
+
 
* Synonym(s):
 
* Synonym(s):
** GA29
+
** a C-terminal [phosphatase 2A protein]-leucine methyl ester
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12322]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-113]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a [phosphatase 2A protein] C-terminal L-leucine methyl ester}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200412 25200412]
+
{{#set: common name=a C-terminal [phosphatase 2A protein]-leucine methyl ester}}
* CHEBI:
+
{{#set: consumed by=RXN-12322}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28040 28040]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C06096 C06096]
+
{{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
+
{{#set: inchi key=InChIKey=BKBYHSYZKIAJDA-LPEMZMRWSA-M}}
+
{{#set: common name=gibberellin A29}}
+
{{#set: molecular weight=347.387    }}
+
{{#set: common name=GA29}}
+
{{#set: produced by=RXN-113}}
+

Revision as of 22:29, 17 March 2018

Metabolite Phosphatase-2A-leucine-methyl-ester

  • common name:
    • a [phosphatase 2A protein] C-terminal L-leucine methyl ester
  • Synonym(s):
    • a C-terminal [phosphatase 2A protein]-leucine methyl ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [phosphatase 2A protein] C-terminal L-leucine methyl ester" cannot be used as a page name in this wiki.
"a C-terminal [phosphatase 2A protein]-leucine methyl ester" cannot be used as a page name in this wiki.