Difference between revisions of "RXN-17013"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17385 CPD-17385] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
 
(Created page with "Category:Gene == Gene Ec-07_004980 == * left end position: ** 4878043 * transcription direction: ** NEGATIVE * right end position: ** 4882747 * centisome position: ** 63.1...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17385 CPD-17385] ==
+
== Gene Ec-07_004980 ==
* smiles:
+
* left end position:
** CCC=CCC=CCC=CCC=CCC=CCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 4878043
* inchi key:
+
* transcription direction:
** InChIKey=KRIFZIRXAAITHR-KWFBMMABSA-J
+
** NEGATIVE
* common name:
+
* right end position:
** (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA
+
** 4882747
* molecular weight:
+
* centisome position:
** 1102.034    
+
** 63.167202    
 
* Synonym(s):
 
* Synonym(s):
** tetracosahexaenoyl-CoA
+
** Esi_0125_0019
** all-cis6,-9,12,15,18,21-tetracosahexaenoyl-CoA
+
** Esi0125_0019
** (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoyl-CoA
+
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-16134]]
+
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
* [[RXN-16132]]
+
***automated-name-match
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=4878043}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581194 71581194]
+
{{#set: transcription direction=NEGATIVE}}
* CHEBI:
+
{{#set: right end position=4882747}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74086 74086]
+
{{#set: centisome position=63.167202   }}
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: common name=Esi_0125_0019|Esi0125_0019}}
{{#set: inchi key=InChIKey=KRIFZIRXAAITHR-KWFBMMABSA-J}}
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
{{#set: common name=(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA}}
+
{{#set: molecular weight=1102.034   }}
+
{{#set: common name=tetracosahexaenoyl-CoA|all-cis6,-9,12,15,18,21-tetracosahexaenoyl-CoA|(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoyl-CoA}}
+
{{#set: consumed by=RXN-16134}}
+
{{#set: produced by=RXN-16132}}
+

Revision as of 22:30, 17 March 2018

Gene Ec-07_004980

  • left end position:
    • 4878043
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4882747
  • centisome position:
    • 63.167202
  • Synonym(s):
    • Esi_0125_0019
    • Esi0125_0019

Reactions associated

Pathways associated

External links