Difference between revisions of "SUCC-S-ALD"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17049 CPD-17049] == * smiles: ** C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2) * inchi key:...") |
(Created page with "Category:Gene == Gene Ec-11_005950 == * left end position: ** 5952886 * transcription direction: ** NEGATIVE * right end position: ** 5971297 * centisome position: ** 94.6...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-11_005950 == |
− | * | + | * left end position: |
− | ** | + | ** 5952886 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 5971297 |
− | * | + | * centisome position: |
− | ** | + | ** 94.64562 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0031_0114 |
− | ** | + | ** Esi0031_0114 |
− | ** | + | ** PP |
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[3.1.3.16-RXN]] |
− | + | ** esiliculosus_genome | |
− | == | + | ***ec-number |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5952886}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | {{#set: | + | {{#set: right end position=5971297}} |
− | {{#set: | + | {{#set: centisome position=94.64562 }} |
− | {{#set: | + | {{#set: common name=Esi_0031_0114|Esi0031_0114|PP}} |
− | {{#set: | + | {{#set: reaction associated=3.1.3.16-RXN}} |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 22:31, 17 March 2018
Gene Ec-11_005950
- left end position:
- 5952886
- transcription direction:
- NEGATIVE
- right end position:
- 5971297
- centisome position:
- 94.64562
- Synonym(s):
- Esi_0031_0114
- Esi0031_0114
- PP
Reactions associated
- 3.1.3.16-RXN
- esiliculosus_genome
- ec-number
- esiliculosus_genome