Difference between revisions of "SUCC-S-ALD"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17049 CPD-17049] == * smiles: ** C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2) * inchi key:...")
 
(Created page with "Category:Gene == Gene Ec-11_005950 == * left end position: ** 5952886 * transcription direction: ** NEGATIVE * right end position: ** 5971297 * centisome position: ** 94.6...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17049 CPD-17049] ==
+
== Gene Ec-11_005950 ==
−
* smiles:
+
* left end position:
−
** C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2)
+
** 5952886
−
* inchi key:
+
* transcription direction:
−
** InChIKey=VZGSJJJQZPTKGR-VXGBXAGGSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine
+
** 5971297
−
* molecular weight:
+
* centisome position:
−
** 298.374    
+
** 94.64562    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-DKP
+
** Esi_0031_0114
−
** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)piperazine-2,5-dione
+
** Esi0031_0114
−
** 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-diketopiperazine
+
** PP
−
** 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-DKP
+
−
** 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)piperazine-2,5-dione
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-15684]]
+
* [[3.1.3.16-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=5952886}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658023 90658023]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2)}}
+
{{#set: right end position=5971297}}
−
{{#set: inchi key=InChIKey=VZGSJJJQZPTKGR-VXGBXAGGSA-N}}
+
{{#set: centisome position=94.64562   }}
−
{{#set: common name=3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: common name=Esi_0031_0114|Esi0031_0114|PP}}
−
{{#set: molecular weight=298.374   }}
+
{{#set: reaction associated=3.1.3.16-RXN}}
−
{{#set: common name=3-benzyl-3,6 -dithio-6-(hydroxymethyl)-DKP|3-benzyl-3,6 -dithio-6-(hydroxymethyl)piperazine-2,5-dione|3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-diketopiperazine|3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-DKP|3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)piperazine-2,5-dione}}
+
−
{{#set: consumed by=RXN-15684}}
+

Revision as of 22:31, 17 March 2018

Gene Ec-11_005950

  • left end position:
    • 5952886
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 5971297
  • centisome position:
    • 94.64562
  • Synonym(s):
    • Esi_0031_0114
    • Esi0031_0114
    • PP

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=SUCC-S-ALD&oldid=13342"