Difference between revisions of "RXN-17794"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-00_008220 == * left end position: ** 13635296 * transcription direction: ** NEGATIVE * right end position: ** 13637643 * centisome position: ** 71...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15301 CPD-15301] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCC2(C(SC)=C(O)C1(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15301 CPD-15301] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCC2(C(SC)=C(O)C1(=C(SC=C1)C(O)=2)) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=UVCQOKDZGIAHDG-UHFFFAOYSA-N |
| − | * | + | * common name: |
| − | ** | + | ** caldariellaquinol |
| − | * | + | * molecular weight: |
| − | ** | + | ** 633.085 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-14451]] | |
| − | + | * [[RXN-15378]] | |
| − | * [[RXN- | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | * [[RXN- | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * LIGAND-CPD: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C20623 C20623] | |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73388 73388] |
| − | {{#set: common name= | + | * METABOLIGHTS : MTBLC73388 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71464569 71464569] |
| + | {{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCC2(C(SC)=C(O)C1(=C(SC=C1)C(O)=2))}} | ||
| + | {{#set: inchi key=InChIKey=UVCQOKDZGIAHDG-UHFFFAOYSA-N}} | ||
| + | {{#set: common name=caldariellaquinol}} | ||
| + | {{#set: molecular weight=633.085 }} | ||
| + | {{#set: produced by=RXN-14451|RXN-15378}} | ||
Revision as of 21:31, 17 March 2018
Contents
Metabolite CPD-15301
- smiles:
- CC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCC2(C(SC)=C(O)C1(=C(SC=C1)C(O)=2))
- inchi key:
- InChIKey=UVCQOKDZGIAHDG-UHFFFAOYSA-N
- common name:
- caldariellaquinol
- molecular weight:
- 633.085
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
