Difference between revisions of "Ec-16 000770"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.100-RXN 2.1.1.100-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** protein C-terminal...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINE NICOTINE] == * smiles: ** C1(CC[CH]([N+](C)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey=S...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINE NICOTINE] == |
− | * | + | * smiles: |
− | ** | + | ** C1(CC[CH]([N+](C)1)C2(C=NC=CC=2)) |
+ | * inchi key: | ||
+ | ** InChIKey=SNICXCGAKADSCV-JTQLQIEISA-O | ||
* common name: | * common name: | ||
− | ** | + | ** (S)-nicotine |
− | * | + | * molecular weight: |
− | ** | + | ** 163.242 |
* Synonym(s): | * Synonym(s): | ||
+ | ** nicotine | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN66-81]] | |
− | + | * [[RXN66-146]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * NCI: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=5065 5065] |
− | * | + | * PUBCHEM: |
− | ** [http://www. | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6919000 6919000] |
− | + | * HMDB : HMDB01934 | |
− | + | * LIGAND-CPD: | |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00745 C00745] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.5294163.html 5294163] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59806 59806] |
− | {{#set: | + | {{#set: smiles=C1(CC[CH]([N+](C)1)C2(C=NC=CC=2))}} |
+ | {{#set: inchi key=InChIKey=SNICXCGAKADSCV-JTQLQIEISA-O}} | ||
+ | {{#set: common name=(S)-nicotine}} | ||
+ | {{#set: molecular weight=163.242 }} | ||
+ | {{#set: common name=nicotine}} | ||
+ | {{#set: consumed by=RXN66-81|RXN66-146}} |
Revision as of 21:33, 17 March 2018
Contents
Metabolite NICOTINE
- smiles:
- C1(CC[CH]([N+](C)1)C2(C=NC=CC=2))
- inchi key:
- InChIKey=SNICXCGAKADSCV-JTQLQIEISA-O
- common name:
- (S)-nicotine
- molecular weight:
- 163.242
- Synonym(s):
- nicotine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(CC[CH]([N+](C)1)C2(C=NC=CC=2))" cannot be used as a page name in this wiki.