Difference between revisions of "GDP-4-DEHYDRO-6-DEOXY-D-MANNOSE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9515 RXN-9515] == * direction: ** LEFT-TO-RIGHT * common name: ** crotonyl-[acyl-carrier protei...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12897 CPD-12897] == * smiles: ** CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12897 CPD-12897] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
+ | * inchi key: | ||
+ | ** InChIKey=LPMIXVANMSEERY-FUEUKBNZSA-J | ||
* common name: | * common name: | ||
− | ** | + | ** 7-methyl-3-oxooct-6-enoyl-CoA |
− | + | * molecular weight: | |
− | + | ** 915.695 | |
− | + | ||
− | * | + | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
+ | ** 7-methyl-3-oxo-6-octenoyl-CoA | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-11917]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986200 50986200] |
− | + | * CHEBI: | |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71410 71410] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16466 C16466] |
− | {{#set: | + | * HMDB : HMDB60421 |
− | {{#set: | + | {{#set: smiles=CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | + | {{#set: inchi key=InChIKey=LPMIXVANMSEERY-FUEUKBNZSA-J}} | |
− | + | {{#set: common name=7-methyl-3-oxooct-6-enoyl-CoA}} | |
+ | {{#set: molecular weight=915.695 }} | ||
+ | {{#set: common name=7-methyl-3-oxo-6-octenoyl-CoA}} | ||
+ | {{#set: consumed by=RXN-11917}} |
Revision as of 22:33, 17 March 2018
Contents
Metabolite CPD-12897
- smiles:
- CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=LPMIXVANMSEERY-FUEUKBNZSA-J
- common name:
- 7-methyl-3-oxooct-6-enoyl-CoA
- molecular weight:
- 915.695
- Synonym(s):
- 7-methyl-3-oxo-6-octenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.