Difference between revisions of "BRANCHED-CHAINAMINOTRANSFERILEU-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17637 CPD-17637] == * smiles: ** CCCCCC(O)CCCCCC([O-])=O * inchi key: ** InChIKey=BNWKMHUFF...")
 
(Created page with "Category:Gene == Gene Ec-11_002590 == * left end position: ** 2711246 * transcription direction: ** NEGATIVE * right end position: ** 2715132 * centisome position: ** 43.1...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17637 CPD-17637] ==
+
== Gene Ec-11_002590 ==
−
* smiles:
+
* left end position:
−
** CCCCCC(O)CCCCCC([O-])=O
+
** 2711246
−
* inchi key:
+
* transcription direction:
−
** InChIKey=BNWKMHUFFKDAMV-UHFFFAOYSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 7-hydroxylaurate
+
** 2715132
−
* molecular weight:
+
* centisome position:
−
** 215.312    
+
** 43.106415    
 
* Synonym(s):
 
* Synonym(s):
−
** 7-hydroxydodecanoic acid
+
** Esi_0048_0023
−
** 7-hydroxylauric acid
+
** Esi0048_0023
−
** 7-hydroxydodecanoate
+
** GST
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12184]]
+
* [[DISULFOXRED-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***go-term
 +
* [[GSHTRAN-RXN]]
 +
** esiliculosus_genome
 +
***ec-number
 +
* [[GST-RXN]]
 +
** esiliculosus_genome
 +
***ec-number
 +
* [[RXN-13673]]
 +
** esiliculosus_genome
 +
***ec-number
 +
* [[RXN-15680]]
 +
** esiliculosus_genome
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-7112]]
 +
* [[PWY-6842]]
 +
* [[PWY-4061]]
 +
* [[PWY-7533]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2711246}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659904 90659904]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=2715132}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84921 84921]
+
{{#set: centisome position=43.106415   }}
−
{{#set: smiles=CCCCCC(O)CCCCCC([O-])=O}}
+
{{#set: common name=Esi_0048_0023|Esi0048_0023|GST}}
−
{{#set: inchi key=InChIKey=BNWKMHUFFKDAMV-UHFFFAOYSA-M}}
+
{{#set: reaction associated=DISULFOXRED-RXN|GSHTRAN-RXN|GST-RXN|RXN-13673|RXN-15680}}
−
{{#set: common name=7-hydroxylaurate}}
+
{{#set: pathway associated=PWY-7112|PWY-6842|PWY-4061|PWY-7533}}
−
{{#set: molecular weight=215.312   }}
+
−
{{#set: common name=7-hydroxydodecanoic acid|7-hydroxylauric acid|7-hydroxydodecanoate}}
+
−
{{#set: consumed by=RXN-12184}}
+

Revision as of 21:34, 17 March 2018

Gene Ec-11_002590

  • left end position:
    • 2711246
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 2715132
  • centisome position:
    • 43.106415
  • Synonym(s):
    • Esi_0048_0023
    • Esi0048_0023
    • GST

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=BRANCHED-CHAINAMINOTRANSFERILEU-RXN&oldid=13541"