Difference between revisions of "RXN-15560"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-CIT HOMO-CIT] == * smiles: ** C(C([O-])=O)CC(O)(C([O-])=O)CC([O-])=O * inchi key: ** InChI...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLUTAMATE-SYNTHASE-NADH-RXN GLUTAMATE-SYNTHASE-NADH-RXN] == * direction: ** LEFT-TO-RIGHT * ec numb...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLUTAMATE-SYNTHASE-NADH-RXN GLUTAMATE-SYNTHASE-NADH-RXN] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.4.1.14 EC-1.4.1.14] |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[NADH]][c] '''+''' 1 [[GLN]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[PROTON]][c] '''=>''' 2 [[GLT]][c] '''+''' 1 [[NAD]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 NADH[c] '''+''' 1 L-glutamine[c] '''+''' 1 2-oxoglutarate[c] '''+''' 1 H+[c] '''=>''' 2 L-glutamate[c] '''+''' 1 NAD+[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Ec-26_004630]] | ||
+ | ** [[pantograph]]-[[aragem]] | ||
+ | == Pathways == | ||
+ | * [[GLUGLNSYN-PWY]], L-glutamate biosynthesis IV: [http://metacyc.org/META/NEW-IMAGE?object=GLUGLNSYN-PWY GLUGLNSYN-PWY] | ||
+ | ** '''1''' reactions found over '''1''' reactions in the full pathway | ||
+ | * [[PWY-6963]], ammonia assimilation cycle I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6963 PWY-6963] | ||
+ | ** '''4''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13753 13753] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00093 R00093] | |
− | * LIGAND- | + | * UNIPROT: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/Q9RXX2 Q9RXX2] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q03460 Q03460] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q22275 Q22275] |
− | * | + | ** [http://www.uniprot.org/uniprot/O61143 O61143] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9C102 Q9C102] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9P540 Q9P540] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: ec number=EC-1.4.1.14}} |
− | {{#set: | + | {{#set: gene associated=Ec-26_004630}} |
− | {{#set: | + | {{#set: in pathway=GLUGLNSYN-PWY|PWY-6963}} |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
− | {{#set: | + | {{#set: reconstruction source=orthology-aragem}} |
+ | {{#set: reconstruction tool=pantograph}} |
Revision as of 22:34, 17 March 2018
Contents
Reaction GLUTAMATE-SYNTHASE-NADH-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 NADH[c] + 1 L-glutamine[c] + 1 2-oxoglutarate[c] + 1 H+[c] => 2 L-glutamate[c] + 1 NAD+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
- GLUGLNSYN-PWY, L-glutamate biosynthesis IV: GLUGLNSYN-PWY
- 1 reactions found over 1 reactions in the full pathway
- PWY-6963, ammonia assimilation cycle I: PWY-6963
- 4 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
External links