Difference between revisions of "RXN-12002"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-cis-D7-tetradecenoyl-ACPs 3-oxo-cis-D7-tetradecenoyl-ACPs] == * common name: ** a 3-oxo-c...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALO-SUCCINATE OXALO-SUCCINATE] == * smiles: ** C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O * inchi...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALO-SUCCINATE OXALO-SUCCINATE] == |
+ | * smiles: | ||
+ | ** C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O | ||
+ | * inchi key: | ||
+ | ** InChIKey=UFSCUAXLTRFIDC-UHFFFAOYSA-K | ||
* common name: | * common name: | ||
− | ** | + | ** oxalosuccinate |
+ | * molecular weight: | ||
+ | ** 187.085 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** oxalo-succ | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-8642]] | ||
+ | * [[RXN-9951]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05379 C05379] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58931 58931] | ||
+ | * METABOLIGHTS : MTBLC58931 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244267 25244267] | ||
+ | * HMDB : HMDB03974 | ||
+ | {{#set: smiles=C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=UFSCUAXLTRFIDC-UHFFFAOYSA-K}} | ||
+ | {{#set: common name=oxalosuccinate}} | ||
+ | {{#set: molecular weight=187.085 }} | ||
+ | {{#set: common name=oxalo-succ}} | ||
+ | {{#set: reversible reaction associated=RXN-8642|RXN-9951}} |
Revision as of 22:35, 17 March 2018
Contents
Metabolite OXALO-SUCCINATE
- smiles:
- C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O
- inchi key:
- InChIKey=UFSCUAXLTRFIDC-UHFFFAOYSA-K
- common name:
- oxalosuccinate
- molecular weight:
- 187.085
- Synonym(s):
- oxalo-succ
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O" cannot be used as a page name in this wiki.