Difference between revisions of "ILE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15124 RXN-15124] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRAZINOIC-ACID PYRAZINOIC-ACID] == * smiles: ** C1(N=CC=NC=1C([O-])=O) * inchi key: ** InChIKe...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15124 RXN-15124] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRAZINOIC-ACID PYRAZINOIC-ACID] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(N=CC=NC=1C([O-])=O)
 +
* inchi key:
 +
** InChIKey=NIPZZXUFJPQHNH-UHFFFAOYSA-M
 +
* common name:
 +
** pyrazine-2-carboxylate
 +
* molecular weight:
 +
** 123.091   
 
* Synonym(s):
 
* Synonym(s):
 +
** pyrazinoate
 +
** pyrazinoic acid
 +
** pyrazinecarboxylic acid
 +
** pyrazinemonocarboxylic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[2-AMINOACRYLATE]][c] '''=>''' 1 [[CPD-16015]][c]
+
* [[PYRAZIN-RXN]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 2-aminoprop-2-enoate[c] '''=>''' 1 2-iminopropanoate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY0-1535]], D-serine degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1535 PWY0-1535]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
* [[TRYPDEG-PWY]], L-tryptophan degradation II (via pyruvate): [http://metacyc.org/META/NEW-IMAGE?object=TRYPDEG-PWY TRYPDEG-PWY]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-3661]], glycine betaine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3661 PWY-3661]
+
−
** '''3''' reactions found over '''7''' reactions in the full pathway
+
−
* [[SERDEG-PWY]], L-serine degradation: [http://metacyc.org/META/NEW-IMAGE?object=SERDEG-PWY SERDEG-PWY]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-5497]], purine nucleobases degradation II (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5497 PWY-5497]
+
−
** '''8''' reactions found over '''24''' reactions in the full pathway
+
−
* [[LCYSDEG-PWY]], L-cysteine degradation II: [http://metacyc.org/META/NEW-IMAGE?object=LCYSDEG-PWY LCYSDEG-PWY]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: in pathway=PWY0-1535|TRYPDEG-PWY|PWY-3661|SERDEG-PWY|PWY-5497|LCYSDEG-PWY}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3728869 3728869]
−
{{#set: reconstruction category=annotation}}
+
* CHEMSPIDER:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://www.chemspider.com/Chemical-Structure.2959374.html 2959374]
−
{{#set: reconstruction source=esiliculosus_genome}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71266 71266]
 +
* NCI:
 +
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=27192 27192]
 +
{{#set: smiles=C1(N=CC=NC=1C([O-])=O)}}
 +
{{#set: inchi key=InChIKey=NIPZZXUFJPQHNH-UHFFFAOYSA-M}}
 +
{{#set: common name=pyrazine-2-carboxylate}}
 +
{{#set: molecular weight=123.091    }}
 +
{{#set: common name=pyrazinoate|pyrazinoic acid|pyrazinecarboxylic acid|pyrazinemonocarboxylic acid}}
 +
{{#set: produced by=PYRAZIN-RXN}}

Revision as of 22:36, 17 March 2018

Metabolite PYRAZINOIC-ACID

  • smiles:
    • C1(N=CC=NC=1C([O-])=O)
  • inchi key:
    • InChIKey=NIPZZXUFJPQHNH-UHFFFAOYSA-M
  • common name:
    • pyrazine-2-carboxylate
  • molecular weight:
    • 123.091
  • Synonym(s):
    • pyrazinoate
    • pyrazinoic acid
    • pyrazinecarboxylic acid
    • pyrazinemonocarboxylic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(N=CC=NC=1C([O-])=O)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=ILE&oldid=13680"