Difference between revisions of "Ec-21 005790"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TMP TMP] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])[O-])O2)) * inchi key: **...") |
(Created page with "Category:Gene == Gene Ec-24_000980 == * left end position: ** 992682 * transcription direction: ** POSITIVE * right end position: ** 999413 * centisome position: ** 19.902...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-24_000980 == |
− | * | + | * left end position: |
− | ** | + | ** 992682 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 999413 |
− | * | + | * centisome position: |
− | ** | + | ** 19.902712 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0019_0088 |
− | ** | + | ** Esi0019_0088 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[2.8.1.6-RXN]] |
− | + | ** esiliculosus_genome | |
− | * [[ | + | ***go-term |
− | * [[RXN- | + | * [[RXN-17472]] |
− | == | + | ** esiliculosus_genome |
− | * [[ | + | ***go-term |
+ | * [[RXN-17473]] | ||
+ | ** esiliculosus_genome | ||
+ | ***go-term | ||
+ | == Pathways associated == | ||
+ | * [[PWY0-1507]] | ||
+ | * [[PWY-7380]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=992682}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=999413}} | |
− | + | {{#set: centisome position=19.902712 }} | |
− | + | {{#set: common name=Esi_0019_0088|Esi0019_0088}} | |
− | + | {{#set: reaction associated=2.8.1.6-RXN|RXN-17472|RXN-17473}} | |
− | + | {{#set: pathway associated=PWY0-1507|PWY-7380}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 21:36, 17 March 2018
Gene Ec-24_000980
- left end position:
- 992682
- transcription direction:
- POSITIVE
- right end position:
- 999413
- centisome position:
- 19.902712
- Synonym(s):
- Esi_0019_0088
- Esi0019_0088
Reactions associated
- 2.8.1.6-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome
- RXN-17472
- esiliculosus_genome
- go-term
- esiliculosus_genome
- RXN-17473
- esiliculosus_genome
- go-term
- esiliculosus_genome