Difference between revisions of "RXN-5462"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3OH-4P-OH-ALPHA-KETOBUTYRATE 3OH-4P-OH-ALPHA-KETOBUTYRATE] == * smiles: ** C(C(C(C([O-])=O)=O)O...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16616 RXN-16616] == * direction: ** LEFT-TO-RIGHT * common name: ** NAD(P)-binding domain * ec...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3OH-4P-OH-ALPHA-KETOBUTYRATE 3OH-4P-OH-ALPHA-KETOBUTYRATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16616 RXN-16616] ==
* smiles:
+
* direction:
** C(C(C(C([O-])=O)=O)O)OP([O-])(=O)[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=MZJFVXDTNBHTKZ-UWTATZPHSA-K
+
 
* common name:
 
* common name:
** (3R)-3-hydroxy-2-oxo-4 phosphonooxybutanoate
+
** NAD(P)-binding domain
* molecular weight:
+
* ec number:
** 211.045   
+
** [http://enzyme.expasy.org/EC/1.1.1.100 EC-1.1.1.100]
 
* Synonym(s):
 
* Synonym(s):
** 3-hydroxy-4-phospho-hydroxy-α-ketobutyrate
 
** 2-oxo-3-hydroxy-4-phosphobutanoate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1 [[NADPH]][c] '''+''' 1 [[5Z-3-oxo-tetradec-5-enoyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[3R-5Z-3-hydroxy-tetradec-5-enoyl-ACPs]][c]
* [[PSERTRANSAMPYR-RXN]]
+
* With common name(s):
 +
** 1 NADPH[c] '''+''' 1 a (5Z)-3-oxo-tetradec-5-enoyl-[acp][c] '''+''' 1 H+[c] '''=>''' 1 NADP+[c] '''+''' 1 a (3R,5Z)-3-hydroxy-tetradec-5-enoyl-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Ec-01_007100]]
 +
** ESILICULOSUS_GENOME
 +
***EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7664]], oleate biosynthesis IV (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7664 PWY-7664]
 +
** '''10''' reactions found over '''14''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.genome.jp/dbget-bin/www_bget?C06054 C06054]
+
{{#set: common name=NAD(P)-binding domain}}
* CHEBI:
+
{{#set: ec number=EC-1.1.1.100}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58538 58538]
+
{{#set: gene associated=Ec-01_007100}}
* BIGG : 1447403
+
{{#set: in pathway=PWY-7664}}
* PUBCHEM:
+
{{#set: reconstruction category=annotation}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266680 45266680]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
* HMDB : HMDB06801
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: smiles=C(C(C(C([O-])=O)=O)O)OP([O-])(=O)[O-]}}
+
{{#set: inchi key=InChIKey=MZJFVXDTNBHTKZ-UWTATZPHSA-K}}
+
{{#set: common name=(3R)-3-hydroxy-2-oxo-4 phosphonooxybutanoate}}
+
{{#set: molecular weight=211.045    }}
+
{{#set: common name=3-hydroxy-4-phospho-hydroxy-α-ketobutyrate|2-oxo-3-hydroxy-4-phosphobutanoate}}
+
{{#set: consumed or produced by=PSERTRANSAMPYR-RXN}}
+

Revision as of 22:37, 17 March 2018

Reaction RXN-16616

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • NAD(P)-binding domain
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7664, oleate biosynthesis IV (anaerobic): PWY-7664
    • 10 reactions found over 14 reactions in the full pathway

Reconstruction information

External links