Difference between revisions of "3-UREIDO-ISOBUTYRATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CH33ADO CH33ADO] == * smiles: ** CC1(C(O)C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))) * inchi key: ** InC...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-PHOSPHATIDYL-ETHANOLAMINE L-1-PHOSPHATIDYL-ETHANOLAMINE] == * common name: ** an L-1-phosph...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-PHOSPHATIDYL-ETHANOLAMINE L-1-PHOSPHATIDYL-ETHANOLAMINE] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an L-1-phosphatidylethanolamine |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a glycerophosphoethanolamine |
| + | ** a phosphatidylethanolamine | ||
| + | ** a 1-phosphatidylethanolamine | ||
| + | ** an L-1-phosphotidylethanolamine | ||
| + | ** a phosphatidylethenolamine | ||
| + | ** an O-(1-β-acyl-2-acyl-sn-glycero-3-phospho)-ethanolamine | ||
| + | ** PtdEtn | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN0-6725]] | ||
| + | * [[2.1.1.17-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]] |
| − | + | ||
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: common name=an L-1-phosphatidylethanolamine}} | |
| − | + | {{#set: common name=a glycerophosphoethanolamine|a phosphatidylethanolamine|a 1-phosphatidylethanolamine|an L-1-phosphotidylethanolamine|a phosphatidylethenolamine|an O-(1-β-acyl-2-acyl-sn-glycero-3-phospho)-ethanolamine|PtdEtn}} | |
| − | + | {{#set: consumed by=RXN0-6725|2.1.1.17-RXN}} | |
| − | + | {{#set: produced by=ETHANOLAMINEPHOSPHOTRANSFERASE-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
Revision as of 21:37, 17 March 2018
Contents
Metabolite L-1-PHOSPHATIDYL-ETHANOLAMINE
- common name:
- an L-1-phosphatidylethanolamine
- Synonym(s):
- a glycerophosphoethanolamine
- a phosphatidylethanolamine
- a 1-phosphatidylethanolamine
- an L-1-phosphotidylethanolamine
- a phosphatidylethenolamine
- an O-(1-β-acyl-2-acyl-sn-glycero-3-phospho)-ethanolamine
- PtdEtn
