Difference between revisions of "Ec-12 000230"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-ASN-tRNAs Charged-ASN-tRNAs] == * common name: ** an L-asparaginyl-[tRNAasn] * Synonym(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11020 CPD-11020] == * smiles: ** C(=O)([O-])C(=O)CC(O)CCl * inchi key: ** InChIKey=FHWPHVIG...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11020 CPD-11020] == |
+ | * smiles: | ||
+ | ** C(=O)([O-])C(=O)CC(O)CCl | ||
+ | * inchi key: | ||
+ | ** InChIKey=FHWPHVIGZZAXIQ-VKHMYHEASA-M | ||
* common name: | * common name: | ||
− | ** | + | ** 5-chloro-4-hydroxy-2-oxopentanoate |
+ | * molecular weight: | ||
+ | ** 165.553 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 5-chloro-4-hydroxy-2-oxovalerate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-11717]] |
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859580 49859580] |
− | {{#set: | + | {{#set: smiles=C(=O)([O-])C(=O)CC(O)CCl}} |
+ | {{#set: inchi key=InChIKey=FHWPHVIGZZAXIQ-VKHMYHEASA-M}} | ||
+ | {{#set: common name=5-chloro-4-hydroxy-2-oxopentanoate}} | ||
+ | {{#set: molecular weight=165.553 }} | ||
+ | {{#set: common name=5-chloro-4-hydroxy-2-oxovalerate}} | ||
+ | {{#set: produced by=RXN-11717}} |
Revision as of 22:37, 17 March 2018
Contents
Metabolite CPD-11020
- smiles:
- C(=O)([O-])C(=O)CC(O)CCl
- inchi key:
- InChIKey=FHWPHVIGZZAXIQ-VKHMYHEASA-M
- common name:
- 5-chloro-4-hydroxy-2-oxopentanoate
- molecular weight:
- 165.553
- Synonym(s):
- 5-chloro-4-hydroxy-2-oxovalerate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(=O)([O-])C(=O)CC(O)CCl" cannot be used as a page name in this wiki.