Difference between revisions of "Ec-08 005610"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11887 RXN-11887] == * direction: ** LEFT-TO-RIGHT * common name: ** Fatty acid hydroxylase * ec...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1130 CPD-1130] == * smiles: ** CCC(C(=O)[O-])C(C([O-])=O)O * inchi key: ** InChIKey=JUCRENB...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11887 RXN-11887] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1130 CPD-1130] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCC(C(=O)[O-])C(C([O-])=O)O
 +
* inchi key:
 +
** InChIKey=JUCRENBZZQKFGK-UHFFFAOYSA-L
 
* common name:
 
* common name:
−
** Fatty acid hydroxylase
+
** 3-ethylmalate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.14.19.20 EC-1.14.19.20]
+
** 160.126   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-14986]]
−
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL]][c] '''+''' 2 [[FERROCYTOCHROME-B5]][c] '''=>''' 2 [[WATER]][c] '''+''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 1 [[CPD-8646]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 oxygen[c] '''+''' 2 H+[c] '''+''' 1 5α-cholesta-7,24-dien-3β-ol[c] '''+''' 2 a ferrocytochrome b5[c] '''=>''' 2 H2O[c] '''+''' 2 a ferricytochrome b5[c] '''+''' 1 7-dehydrodesmosterol[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-01_003780]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY66-4]], cholesterol biosynthesis III (via desmosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-4 PWY66-4]
+
−
** '''9''' reactions found over '''22''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=34004 34004]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21145023 21145023]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEMSPIDER:
−
{{#set: common name=Fatty acid hydroxylase}}
+
** [http://www.chemspider.com/Chemical-Structure.20015785.html 20015785]
−
{{#set: ec number=EC-1.14.19.20}}
+
* CHEBI:
−
{{#set: gene associated=Ec-01_003780}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57425 57425]
−
{{#set: in pathway=PWY66-4}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01989 C01989]
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: smiles=CCC(C(=O)[O-])C(C([O-])=O)O}}
−
{{#set: reconstruction source=esiliculosus_genome}}
+
{{#set: inchi key=InChIKey=JUCRENBZZQKFGK-UHFFFAOYSA-L}}
 +
{{#set: common name=3-ethylmalate}}
 +
{{#set: molecular weight=160.126    }}
 +
{{#set: consumed by=RXN-14986}}

Revision as of 21:37, 17 March 2018

Metabolite CPD-1130

  • smiles:
    • CCC(C(=O)[O-])C(C([O-])=O)O
  • inchi key:
    • InChIKey=JUCRENBZZQKFGK-UHFFFAOYSA-L
  • common name:
    • 3-ethylmalate
  • molecular weight:
    • 160.126
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC(C(=O)[O-])C(C([O-])=O)O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-08_005610&oldid=13768"