Difference between revisions of "CPD-659"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_ZN+2 ExchangeSeed_ZN+2] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formu...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ALPHA-HYDROXYETHYL-THPP 2-ALPHA-HYDROXYETHYL-THPP] == * smiles: ** CC2(=C(SC(C(C)O)=[N+](CC1(...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_ZN+2 ExchangeSeed_ZN+2] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ALPHA-HYDROXYETHYL-THPP 2-ALPHA-HYDROXYETHYL-THPP] ==
* direction:
+
* smiles:
** REVERSIBLE
+
** CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])
 +
* inchi key:
 +
** InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L
 +
* common name:
 +
** 2-(α-hydroxyethyl)thiamine diphosphate
 +
* molecular weight:
 +
** 466.341   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-(α-hydroxyethyl)-TPP
 +
** 2-(α-hydroxyethyl)-ThPP
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-12508]]
** 1.0 [[ZN+2]][C-BOUNDARY] '''<=>''' 1.0 [[ZN+2]][e]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-12583]]
** 1.0 Zn2+[C-BOUNDARY] '''<=>''' 1.0 Zn2+[e]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
== Pathways  ==
+
== Reconstruction information  ==
+
* [[manual]]:
+
** [[added to manage seeds from boundary to extracellular compartment]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
{{#set: in pathway=}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878487 46878487]
{{#set: reconstruction category=manual}}
+
* CHEBI:
{{#set: reconstruction source=added to manage seeds from boundary to extracellular compartment}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58939 58939]
 +
{{#set: smiles=CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])}}
 +
{{#set: inchi key=InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L}}
 +
{{#set: common name=2-(&alpha;-hydroxyethyl)thiamine diphosphate}}
 +
{{#set: molecular weight=466.341    }}
 +
{{#set: common name=2-(&alpha;-hydroxyethyl)-TPP|2-(&alpha;-hydroxyethyl)-ThPP}}
 +
{{#set: consumed by=RXN-12508}}
 +
{{#set: produced by=RXN-12583}}

Revision as of 21:39, 17 March 2018

Metabolite 2-ALPHA-HYDROXYETHYL-THPP

  • smiles:
    • CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])
  • inchi key:
    • InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L
  • common name:
    • 2-(α-hydroxyethyl)thiamine diphosphate
  • molecular weight:
    • 466.341
  • Synonym(s):
    • 2-(α-hydroxyethyl)-TPP
    • 2-(α-hydroxyethyl)-ThPP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])" cannot be used as a page name in this wiki.