Difference between revisions of "TRNA-Containing-5MeAminoMe-2-ThioU"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=4.2.3.12-RXN 4.2.3.12-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** 6-pyruvoyl tetrahydro...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=4.2.3.12-RXN 4.2.3.12-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N
 
* common name:
 
* common name:
−
** 6-pyruvoyl tetrahydropterin synthase/QueD family protein
+
** isofucosterol
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/4.2.3.12 EC-4.2.3.12]
+
** 412.698   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[DIHYDRONEOPTERIN-P3]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[6-PYRUVOYL-5678-TETRAHYDROPTERIN]][c] '''+''' 1 [[P3I]][c]
+
* [[RXN-4210]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 7,8-dihydroneopterin 3'-triphosphate[c] '''=>''' 1 H+[c] '''+''' 1 6-pyruvoyl tetrahydropterin[c] '''+''' 1 PPPi[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-27_003470]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Ec-10_002190]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-5664]], tetrahydrobiopterin biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5664 PWY-5664]
+
−
** '''2''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-5663]], tetrahydrobiopterin biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5663 PWY-5663]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-7442]], drosopterin and aurodrosopterin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7442 PWY-7442]
+
−
** '''2''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-6983]], tetrahydrobiopterin biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6983 PWY-6983]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22048 22048]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244964 25244964]
−
* LIGAND-RXN:
+
* LIGAND-CPD:
−
** [http://www.genome.jp/dbget-bin/www_bget?R04286 R04286]
+
** [http://www.genome.jp/dbget-bin/www_bget?C08821 C08821]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* HMDB : HMDB02374
−
{{#set: common name=6-pyruvoyl tetrahydropterin synthase/QueD family protein}}
+
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
−
{{#set: ec number=EC-4.2.3.12}}
+
{{#set: inchi key=InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N}}
−
{{#set: gene associated=Ec-27_003470|Ec-10_002190}}
+
{{#set: common name=isofucosterol}}
−
{{#set: in pathway=PWY-5664|PWY-5663|PWY-7442|PWY-6983}}
+
{{#set: molecular weight=412.698    }}
−
{{#set: reconstruction category=annotation}}
+
{{#set: produced by=RXN-4210}}
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Revision as of 22:40, 17 March 2018

Metabolite CPD-4127

  • smiles:
    • CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N
  • common name:
    • isofucosterol
  • molecular weight:
    • 412.698
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=TRNA-Containing-5MeAminoMe-2-ThioU&oldid=13977"