Difference between revisions of "RXN-969"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-12_006450 == * left end position: ** 5765397 * transcription direction: ** NEGATIVE * right end position: ** 5782210 * centisome position: ** 69.1...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-PROPIONYL-COA 3-HYDROXY-PROPIONYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-PROPIONYL-COA 3-HYDROXY-PROPIONYL-COA] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCO)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=BERBFZCUSMQABM-IEXPHMLFSA-J |
− | * | + | * common name: |
− | ** | + | ** 3-hydroxypropanoyl-CoA |
− | * | + | * molecular weight: |
− | ** | + | ** 835.566 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3-hydroxypropionyl-coenzyme A |
− | ** | + | ** 3-hydroxypropionyl-CoA |
+ | ** 3-hydroxypropanoyl coenzymeA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-6383]] | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05668 C05668] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58528 58528] |
− | {{#set: common name= | + | * METABOLIGHTS : MTBLC58528 |
− | {{#set: reaction associated= | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229175 44229175] | ||
+ | * HMDB : HMDB06807 | ||
+ | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCO)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
+ | {{#set: inchi key=InChIKey=BERBFZCUSMQABM-IEXPHMLFSA-J}} | ||
+ | {{#set: common name=3-hydroxypropanoyl-CoA}} | ||
+ | {{#set: molecular weight=835.566 }} | ||
+ | {{#set: common name=3-hydroxypropionyl-coenzyme A|3-hydroxypropionyl-CoA|3-hydroxypropanoyl coenzymeA}} | ||
+ | {{#set: reversible reaction associated=RXN-6383}} |
Revision as of 22:44, 17 March 2018
Contents
Metabolite 3-HYDROXY-PROPIONYL-COA
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCO)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=BERBFZCUSMQABM-IEXPHMLFSA-J
- common name:
- 3-hydroxypropanoyl-CoA
- molecular weight:
- 835.566
- Synonym(s):
- 3-hydroxypropionyl-coenzyme A
- 3-hydroxypropionyl-CoA
- 3-hydroxypropanoyl coenzymeA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCO)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.