Difference between revisions of "Thiopurines"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLC-6-P ALPHA-GLC-6-P] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1) * inchi...") |
(Created page with "Category:Gene == Gene Ec-01_003500 == * left end position: ** 2963967 * transcription direction: ** POSITIVE * right end position: ** 2965610 * centisome position: ** 28.7...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_003500 == |
− | * | + | * left end position: |
− | ** | + | ** 2963967 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2965610 |
− | * | + | * centisome position: |
− | ** | + | ** 28.723856 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0003_0266 |
− | ** | + | ** Esi0003_0266 |
− | == | + | == Reactions associated == |
− | * [[ | + | * [[PRTRANS-RXN]] |
− | + | ** esiliculosus_genome | |
− | == | + | ***ec-number |
− | * [[ | + | ** [[pantograph]]-[[aragem]] |
+ | == Pathways associated == | ||
+ | * [[TRPSYN-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2963967}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2965610}} | |
− | + | {{#set: centisome position=28.723856 }} | |
− | + | {{#set: common name=Esi_0003_0266|Esi0003_0266}} | |
− | + | {{#set: reaction associated=PRTRANS-RXN}} | |
− | + | {{#set: pathway associated=TRPSYN-PWY}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 21:47, 17 March 2018
Gene Ec-01_003500
- left end position:
- 2963967
- transcription direction:
- POSITIVE
- right end position:
- 2965610
- centisome position:
- 28.723856
- Synonym(s):
- Esi_0003_0266
- Esi0003_0266
Reactions associated
- PRTRANS-RXN
- esiliculosus_genome
- ec-number
- pantograph-aragem
- esiliculosus_genome