Difference between revisions of "Unsulfurated-Sulfur-Acceptors"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXY-BUTANONE-P DIHYDROXY-BUTANONE-P] == * smiles: ** CC(=O)C(O)COP(=O)([O-])[O-] * inchi...") |
(Created page with "Category:Gene == Gene Ec-14_001590 == * left end position: ** 1497985 * transcription direction: ** NEGATIVE * right end position: ** 1502740 * centisome position: ** 22.8...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-14_001590 == |
− | * | + | * left end position: |
− | ** | + | ** 1497985 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 1502740 |
− | * | + | * centisome position: |
− | ** | + | ** 22.833647 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0182_0008 |
− | ** | + | ** Esi0182_0008 |
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[GUANYL-KIN-RXN]] |
− | + | ** esiliculosus_genome | |
− | * [[ | + | ***go-term |
− | == | + | ** [[pantograph]]-[[aragem]] |
+ | == Pathways associated == | ||
+ | * [[PWY-7221]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1497985}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=1502740}} | |
− | + | {{#set: centisome position=22.833647 }} | |
− | + | {{#set: common name=Esi_0182_0008|Esi0182_0008}} | |
− | + | {{#set: reaction associated=GUANYL-KIN-RXN}} | |
− | + | {{#set: pathway associated=PWY-7221}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 21:47, 17 March 2018
Gene Ec-14_001590
- left end position:
- 1497985
- transcription direction:
- NEGATIVE
- right end position:
- 1502740
- centisome position:
- 22.833647
- Synonym(s):
- Esi_0182_0008
- Esi0182_0008
Reactions associated
- GUANYL-KIN-RXN
- esiliculosus_genome
- go-term
- pantograph-aragem
- esiliculosus_genome