Difference between revisions of "RXN-12625"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-06_009510 == * left end position: ** 7320030 * transcription direction: ** NEGATIVE * right end position: ** 7338530 * centisome position: ** 83.5...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11715 CPD-11715] == * smiles: ** C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1) * inchi key: ** InChIKey=...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-06_009510 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11715 CPD-11715] ==
−
* left end position:
+
* smiles:
−
** 7320030
+
** C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1)
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=UTYVDVLMYQPLQB-UHFFFAOYSA-M
−
* right end position:
+
* common name:
−
** 7338530
+
** phenylacetylglycine
−
* centisome position:
+
* molecular weight:
−
** 83.58338    
+
** 192.194    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0086_0041
+
** phenaceturic acid
−
** Esi0086_0041
+
** phenacetylglycine
 +
** N-phenacetylglycine
 +
** N-phenylacetylglycine
 +
** N-(phenylacetyl)glycine
 +
** glycine, N-(phenylacetyl)-
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[1-PHOSPHATIDYLINOSITOL-KINASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** esiliculosus_genome
+
* [[RXN-10821]]
−
***go-term
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
−
* [[PWY-6352]]
+
−
* [[PWY-6351]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=7320030}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4229702 4229702]
−
{{#set: right end position=7338530}}
+
* CHEMSPIDER:
−
{{#set: centisome position=83.58338   }}
+
** [http://www.chemspider.com/Chemical-Structure.3438658.html 3438658]
−
{{#set: common name=Esi_0086_0041|Esi0086_0041}}
+
* CHEBI:
−
{{#set: reaction associated=1-PHOSPHATIDYLINOSITOL-KINASE-RXN}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60874 60874]
−
{{#set: pathway associated=PWY-6352|PWY-6351}}
+
{{#set: smiles=C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1)}}
 +
{{#set: inchi key=InChIKey=UTYVDVLMYQPLQB-UHFFFAOYSA-M}}
 +
{{#set: common name=phenylacetylglycine}}
 +
{{#set: molecular weight=192.194   }}
 +
{{#set: common name=phenaceturic acid|phenacetylglycine|N-phenacetylglycine|N-phenylacetylglycine|N-(phenylacetyl)glycine|glycine, N-(phenylacetyl)-}}
 +
{{#set: produced by=RXN-10821}}

Revision as of 22:47, 17 March 2018

Metabolite CPD-11715

  • smiles:
    • C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1)
  • inchi key:
    • InChIKey=UTYVDVLMYQPLQB-UHFFFAOYSA-M
  • common name:
    • phenylacetylglycine
  • molecular weight:
    • 192.194
  • Synonym(s):
    • phenaceturic acid
    • phenacetylglycine
    • N-phenacetylglycine
    • N-phenylacetylglycine
    • N-(phenylacetyl)glycine
    • glycine, N-(phenylacetyl)-

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-12625&oldid=14464"