Difference between revisions of "SPERMIDINESYN-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16817 CPD-16817] == * smiles: ** C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2)) * inchi key: ** In...")
 
(Created page with "Category:Gene == Gene Ec-21_003280 == * left end position: ** 4244374 * transcription direction: ** NEGATIVE * right end position: ** 4248288 * centisome position: ** 57.5...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16817 CPD-16817] ==
+
== Gene Ec-21_003280 ==
−
* smiles:
+
* left end position:
−
** C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2))
+
** 4244374
−
* inchi key:
+
* transcription direction:
−
** InChIKey=BXFFHSIDQOFMLE-UHFFFAOYSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** indoxyl sulfate
+
** 4248288
−
* molecular weight:
+
* centisome position:
−
** 212.2    
+
** 57.510918    
 
* Synonym(s):
 
* Synonym(s):
−
** indol-3-yl sulfate
+
** Esi_0072_0034
 +
** Esi0072_0034
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** esiliculosus_genome
−
* [[RXN-15587]]
+
***automated-name-match
 +
== Pathways associated ==
 +
* [[TRIGLSYN-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4244374}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4453098 4453098]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=4248288}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=43355 43355]
+
{{#set: centisome position=57.510918   }}
−
* HMDB : HMDB00682
+
{{#set: common name=Esi_0072_0034|Esi0072_0034}}
−
{{#set: smiles=C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2))}}
+
{{#set: reaction associated=DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN}}
−
{{#set: inchi key=InChIKey=BXFFHSIDQOFMLE-UHFFFAOYSA-M}}
+
{{#set: pathway associated=TRIGLSYN-PWY}}
−
{{#set: common name=indoxyl sulfate}}
+
−
{{#set: molecular weight=212.2   }}
+
−
{{#set: common name=indol-3-yl sulfate}}
+
−
{{#set: consumed or produced by=RXN-15587}}
+

Revision as of 21:49, 17 March 2018

Gene Ec-21_003280

  • left end position:
    • 4244374
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4248288
  • centisome position:
    • 57.510918
  • Synonym(s):
    • Esi_0072_0034
    • Esi0072_0034

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=SPERMIDINESYN-RXN&oldid=14582"