Difference between revisions of "Ec-10 001500"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIOTIN BIOTIN] == * smiles: ** C1(SC(CCCCC(=O)[O-])[CH]2(NC(=O)N[CH]12)) * inchi key: ** InChIK...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Substituted-Amino-Acids N-Substituted-Amino-Acids] == * common name: ** an N-modified amino a...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Substituted-Amino-Acids N-Substituted-Amino-Acids] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** an N-modified amino acid |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** an N-substituted amino acid |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[AMINOCYL-TRNA-HYDROLASE-RXN]] |
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
== External links == | == External links == | ||
− | + | {{#set: common name=an N-modified amino acid}} | |
− | + | {{#set: common name=an N-substituted amino acid}} | |
− | + | {{#set: produced by=AMINOCYL-TRNA-HYDROLASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 21:49, 17 March 2018
Contents
Metabolite N-Substituted-Amino-Acids
- common name:
- an N-modified amino acid
- Synonym(s):
- an N-substituted amino acid