Difference between revisions of "CREATINE-KINASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-D-LACTONE GLC-D-LACTONE] == * smiles: ** C(O)C1(OC(C(C(C1O)O)O)=O) * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene Ec-26_006010 == * left end position: ** 6071767 * transcription direction: ** NEGATIVE * right end position: ** 6075984 * centisome position: ** 92.2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-26_006010 == |
− | * | + | * left end position: |
− | ** | + | ** 6071767 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 6075984 |
− | * | + | * centisome position: |
− | ** | + | ** 92.22917 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0059_0058 |
− | ** | + | ** Esi0059_0058 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[CERAMIDASE-RXN]] |
− | + | ** esiliculosus_genome | |
− | == | + | ***automated-name-match |
− | * [[ | + | * [[CERAMIDASE-YEAST-RXN]] |
+ | ** esiliculosus_genome | ||
+ | ***automated-name-match | ||
+ | * [[RXN-11375]] | ||
+ | ** esiliculosus_genome | ||
+ | ***automated-name-match | ||
+ | * [[RXN-13733]] | ||
+ | ** esiliculosus_genome | ||
+ | ***automated-name-match | ||
+ | * [[RXN-646]] | ||
+ | ** [[pantograph]]-[[aragem]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY3DJ-11470]] | ||
+ | * [[PWY-7128]] | ||
+ | * [[PWY-5033]] | ||
+ | * [[PWY-6993]] | ||
+ | * [[PWY-722]] | ||
+ | * [[PWY-6483]] | ||
+ | * [[PWY-7119]] | ||
+ | * [[PWY66-388]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=6071767}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=6075984}} | |
− | + | {{#set: centisome position=92.22917 }} | |
− | + | {{#set: common name=Esi_0059_0058|Esi0059_0058}} | |
− | + | {{#set: reaction associated=CERAMIDASE-RXN|CERAMIDASE-YEAST-RXN|RXN-11375|RXN-13733|RXN-646}} | |
− | + | {{#set: pathway associated=PWY3DJ-11470|PWY-7128|PWY-5033|PWY-6993|PWY-722|PWY-6483|PWY-7119|PWY66-388}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Revision as of 22:50, 17 March 2018
Gene Ec-26_006010
- left end position:
- 6071767
- transcription direction:
- NEGATIVE
- right end position:
- 6075984
- centisome position:
- 92.22917
- Synonym(s):
- Esi_0059_0058
- Esi0059_0058
Reactions associated
- CERAMIDASE-RXN
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome
- CERAMIDASE-YEAST-RXN
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome
- RXN-11375
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome
- RXN-13733
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome
- RXN-646