Difference between revisions of "Jasmonic-Acids"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-04_004960 == * left end position: ** 5047328 * transcription direction: ** NEGATIVE * right end position: ** 5054883 * centisome position: ** 77.5...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEATE MALEATE] == * smiles: ** C([O-])(=O)C=CC([O-])=O * inchi key: ** InChIKey=VZCYOOQTPOCHF...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEATE MALEATE] == |
− | * | + | * smiles: |
− | ** | + | ** C([O-])(=O)C=CC([O-])=O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=VZCYOOQTPOCHFL-UPHRSURJSA-L |
− | * | + | * common name: |
− | ** | + | ** maleate |
− | * | + | * molecular weight: |
− | ** | + | ** 114.057 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** maleic acid |
− | ** | + | ** cis-butenedioic acid |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-646]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 110-16-7 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5288227 5288227] |
− | {{#set: | + | * HMDB : HMDB00176 |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01384 C01384] | |
− | {{#set: | + | * CHEMSPIDER: |
+ | ** [http://www.chemspider.com/Chemical-Structure.4450430.html 4450430] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30780 30780] | ||
+ | {{#set: smiles=C([O-])(=O)C=CC([O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=VZCYOOQTPOCHFL-UPHRSURJSA-L}} | ||
+ | {{#set: common name=maleate}} | ||
+ | {{#set: molecular weight=114.057 }} | ||
+ | {{#set: common name=maleic acid|cis-butenedioic acid}} | ||
+ | {{#set: produced by=RXN-646}} |
Revision as of 21:50, 17 March 2018
Contents
Metabolite MALEATE
- smiles:
- C([O-])(=O)C=CC([O-])=O
- inchi key:
- InChIKey=VZCYOOQTPOCHFL-UPHRSURJSA-L
- common name:
- maleate
- molecular weight:
- 114.057
- Synonym(s):
- maleic acid
- cis-butenedioic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 110-16-7
- PUBCHEM:
- HMDB : HMDB00176
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
"C([O-])(=O)C=CC([O-])=O" cannot be used as a page name in this wiki.