Difference between revisions of "RXN0-901"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-1-P GLC-1-P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi key: ** InCh...") |
(Created page with "Category:Gene == Gene Ec-sdr_f_000030 == * Synonym(s): ** FeV4scaf02_1 == Reactions associated == * 3-ISOPROPYLMALISOM-RXN ** pantograph-aragem * RXN-8991...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-sdr_f_000030 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** FeV4scaf02_1 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * [[3-ISOPROPYLMALISOM-RXN]] | |
− | + | ** [[pantograph]]-[[aragem]] | |
− | * [[RXN- | + | * [[RXN-8991]] |
− | * [[RXN- | + | ** [[pantograph]]-[[aragem]] |
− | * [[ | + | == Pathways associated == |
− | * [[ | + | * [[LEUSYN-PWY]] |
− | * [[ | + | * [[PWY-6871]] |
== External links == | == External links == | ||
− | + | {{#set: common name=FeV4scaf02_1}} | |
− | + | {{#set: reaction associated=3-ISOPROPYLMALISOM-RXN|RXN-8991}} | |
− | + | {{#set: pathway associated=LEUSYN-PWY|PWY-6871}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 22:50, 17 March 2018
Gene Ec-sdr_f_000030
- Synonym(s):
- FeV4scaf02_1