Difference between revisions of "RXN1G-469"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4201 CPD-4201] == * smiles: ** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])...")
 
(Created page with "Category:Gene == Gene Ec-10_001500 == * left end position: ** 1558309 * transcription direction: ** NEGATIVE * right end position: ** 1565770 * centisome position: ** 23.9...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4201 CPD-4201] ==
+
== Gene Ec-10_001500 ==
−
* smiles:
+
* left end position:
−
** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)([O-])=O)O)O))C=NC=23)))C
+
** 1558309
−
* inchi key:
+
* transcription direction:
−
** InChIKey=OPLVZTYVQUWKHB-SDBHATRESA-K
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** N6-(Δ2-isopentenyl)-adenosine 5'-triphosphate
+
** 1565770
−
* molecular weight:
+
* centisome position:
−
** 572.278    
+
** 23.970352    
 
* Synonym(s):
 
* Synonym(s):
−
** iPTP
+
** Esi_0073_0128
−
** isopentenyladenosine riboside-5'-triphosphate
+
** Esi0073_0128
−
** iPRTP
+
** ArgRS
−
** isopentenyladenosine-5'-triphosphate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[ARGINYLTRANSFERASE-RXN]]
−
* [[RXN-4303]]
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1558309}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203647 25203647]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=1565770}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71679 71679]
+
{{#set: centisome position=23.970352   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0073_0128|Esi0073_0128|ArgRS}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16424 C16424]
+
{{#set: reaction associated=ARGINYLTRANSFERASE-RXN}}
−
{{#set: smiles=CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)([O-])=O)O)O))C=NC=23)))C}}
+
−
{{#set: inchi key=InChIKey=OPLVZTYVQUWKHB-SDBHATRESA-K}}
+
−
{{#set: common name=N6-(Δ2-isopentenyl)-adenosine 5'-triphosphate}}
+
−
{{#set: molecular weight=572.278   }}
+
−
{{#set: common name=iPTP|isopentenyladenosine riboside-5'-triphosphate|iPRTP|isopentenyladenosine-5'-triphosphate}}
+
−
{{#set: produced by=RXN-4303}}
+

Revision as of 21:50, 17 March 2018

Gene Ec-10_001500

  • left end position:
    • 1558309
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1565770
  • centisome position:
    • 23.970352
  • Synonym(s):
    • Esi_0073_0128
    • Esi0073_0128
    • ArgRS

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN1G-469&oldid=14666"