Difference between revisions of "Ec-20 004180"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLUTATHIONE-REDUCT-NADPH-RXN GLUTATHIONE-REDUCT-NADPH-RXN] == * direction: ** LEFT-TO-RIGHT * commo...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7117 CPD-7117] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7117 CPD-7117] == |
− | * | + | * smiles: |
− | ** | + | ** C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4))) |
+ | * inchi key: | ||
+ | ** InChIKey=XENHPQQLDPAYIJ-PEVLUNPASA-M | ||
* common name: | * common name: | ||
− | ** | + | ** delphinidin-3-O-β-D-glucoside |
− | + | * molecular weight: | |
− | * | + | ** 463.374 |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
+ | ** delfinidin-3-O-glucoside | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-8228]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * LIPID_MAPS : LMPK12010278 |
− | * | + | * PUBCHEM: |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=165559 165559] | |
− | ** [http:// | + | * CHEBI: |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=31463 31463] | |
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C12138 C12138] | |
− | * | + | * HMDB : HMDB37997 |
− | ** [http://www. | + | {{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4)))}} |
− | + | {{#set: inchi key=InChIKey=XENHPQQLDPAYIJ-PEVLUNPASA-M}} | |
− | + | {{#set: common name=delphinidin-3-O-β-D-glucoside}} | |
− | * | + | {{#set: molecular weight=463.374 }} |
− | ** [http://www. | + | {{#set: common name=delfinidin-3-O-glucoside}} |
− | * | + | {{#set: consumed by=RXN-8228}} |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Revision as of 21:52, 17 March 2018
Contents
Metabolite CPD-7117
- smiles:
- C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4)))
- inchi key:
- InChIKey=XENHPQQLDPAYIJ-PEVLUNPASA-M
- common name:
- delphinidin-3-O-β-D-glucoside
- molecular weight:
- 463.374
- Synonym(s):
- delfinidin-3-O-glucoside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4)))" cannot be used as a page name in this wiki.