Difference between revisions of "SINAPYL-ALCOHOL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-UREIDOHOMOSERINE O-UREIDOHOMOSERINE] == * smiles: ** C(CC(C(=O)[O-])[N+])ONC(N)=O * inchi key...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1106 RXN-1106] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1106 RXN-1106] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | * ec number: | |
| − | + | ** [http://enzyme.expasy.org/EC/1.2.1.44 EC-1.2.1.44] | |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[FERULOYL-COA]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CONIFERYL-ALDEHYDE]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[NADP]][c] |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1 feruloyl-CoA[c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 1 coniferaldehyde[c] '''+''' 1 coenzyme A[c] '''+''' 1 NADP+[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Ec-12_005240]] | ||
| + | ** [[pantograph]]-[[aragem]] | ||
| + | * [[Ec-23_001220]] | ||
| + | ** [[pantograph]]-[[aragem]] | ||
| + | * [[Ec-12_001350]] | ||
| + | ** [[pantograph]]-[[aragem]] | ||
| + | == Pathways == | ||
| + | * [[PWY-6027]], capsiconiate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6027 PWY-6027] | ||
| + | ** '''1''' reactions found over '''4''' reactions in the full pathway | ||
| + | * [[PWY-361]], phenylpropanoid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-361 PWY-361] | ||
| + | ** '''7''' reactions found over '''15''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-aragem]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | * | + | * LIGAND-RXN: |
| − | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02193 R02193] |
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | {{#set: | + | {{#set: ec number=EC-1.2.1.44}} |
| − | {{#set: | + | {{#set: gene associated=Ec-12_005240|Ec-23_001220|Ec-12_001350}} |
| − | {{#set: | + | {{#set: in pathway=PWY-6027|PWY-361}} |
| − | {{#set: | + | {{#set: reconstruction category=orthology}} |
| − | {{#set: | + | {{#set: reconstruction source=orthology-aragem}} |
| − | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
Revision as of 21:52, 17 March 2018
Contents
Reaction RXN-1106
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 FERULOYL-COA[c] + 1 NADPH[c] + 1 PROTON[c] => 1 CONIFERYL-ALDEHYDE[c] + 1 CO-A[c] + 1 NADP[c]
- With common name(s):
- 1 feruloyl-CoA[c] + 1 NADPH[c] + 1 H+[c] => 1 coniferaldehyde[c] + 1 coenzyme A[c] + 1 NADP+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
- PWY-6027, capsiconiate biosynthesis: PWY-6027
- 1 reactions found over 4 reactions in the full pathway
- PWY-361, phenylpropanoid biosynthesis: PWY-361
- 7 reactions found over 15 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
External links
- LIGAND-RXN:
