Difference between revisions of "RXN-15130"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-696 CPD-696] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC...")
 
(Created page with "Category:Gene == Gene Ec-26_002300 == * left end position: ** 2659614 * transcription direction: ** POSITIVE * right end position: ** 2669310 * centisome position: ** 40.3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-696 CPD-696] ==
+
== Gene Ec-26_002300 ==
−
* smiles:
+
* left end position:
−
** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
+
** 2659614
−
* inchi key:
+
* transcription direction:
−
** InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 24-methylenecycloartanol
+
** 2669310
−
* molecular weight:
+
* centisome position:
−
** 440.751    
+
** 40.39911    
 
* Synonym(s):
 
* Synonym(s):
−
** 24(28)-methylenecycloartanol
+
** Esi_0274_0001
 +
** Esi0274_0001
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[ATPASE-RXN]]
−
* [[RXN-4021]]
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2659614}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658794 90658794]
+
{{#set: transcription direction=POSITIVE}}
−
* LIGAND-CPD:
+
{{#set: right end position=2669310}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08830 C08830]
+
{{#set: centisome position=40.39911   }}
−
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))}}
+
{{#set: common name=Esi_0274_0001|Esi0274_0001}}
−
{{#set: inchi key=InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N}}
+
{{#set: reaction associated=ATPASE-RXN}}
−
{{#set: common name=24-methylenecycloartanol}}
+
−
{{#set: molecular weight=440.751   }}
+
−
{{#set: common name=24(28)-methylenecycloartanol}}
+
−
{{#set: produced by=RXN-4021}}
+

Revision as of 22:53, 17 March 2018

Gene Ec-26_002300

  • left end position:
    • 2659614
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2669310
  • centisome position:
    • 40.39911
  • Synonym(s):
    • Esi_0274_0001
    • Esi0274_0001

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-15130&oldid=14897"