Difference between revisions of "ACYL-COA-OXIDASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-202 CPD-202] == * smiles: ** CC(CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP...")
 
(Created page with "Category:Gene == Gene Ec-14_001310 == * left end position: ** 1295374 * transcription direction: ** POSITIVE * right end position: ** 1313684 * centisome position: ** 19.7...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-202 CPD-202] ==
+
== Gene Ec-14_001310 ==
−
* smiles:
+
* left end position:
−
** CC(CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])[CH]5(CC[CH]6([CH]7(C(O)C[CH]4(CC(O)CCC(C)4[CH](CC(O)C(C)56)7))))
+
** 1295374
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZKWNOTQHFKYUNU-JGCIYWTLSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** choloyl-CoA
+
** 1313684
−
* molecular weight:
+
* centisome position:
−
** 1154.064    
+
** 19.745266    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-α,7-α,12-α-trihydroxy-5-β-cholanoyl-CoA
+
** Esi_0182_0049
−
** 3α,7α,12α-trihydroxy-5β-cholan-24-oyl-CoA
+
** Esi0182_0049
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
−
* [[2.3.1.176-RXN]]
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1295374}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657878 90657878]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=1313684}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15519 15519]
+
{{#set: centisome position=19.745266   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0182_0049|Esi0182_0049}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01794 C01794]
+
{{#set: reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}}
−
* HMDB : HMDB01374
+
−
{{#set: smiles=CC(CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])[CH]5(CC[CH]6([CH]7(C(O)C[CH]4(CC(O)CCC(C)4[CH](CC(O)C(C)56)7))))}}
+
−
{{#set: inchi key=InChIKey=ZKWNOTQHFKYUNU-JGCIYWTLSA-J}}
+
−
{{#set: common name=choloyl-CoA}}
+
−
{{#set: molecular weight=1154.064   }}
+
−
{{#set: common name=3-α,7-α,12-α-trihydroxy-5-β-cholanoyl-CoA|3α,7α,12α-trihydroxy-5β-cholan-24-oyl-CoA}}
+
−
{{#set: produced by=2.3.1.176-RXN}}
+

Revision as of 21:53, 17 March 2018

Gene Ec-14_001310

  • left end position:
    • 1295374
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1313684
  • centisome position:
    • 19.745266
  • Synonym(s):
    • Esi_0182_0049
    • Esi0182_0049

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=ACYL-COA-OXIDASE-RXN&oldid=14919"