Difference between revisions of "Ec-21 005710"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-27_006560 == * left end position: ** 6029490 * transcription direction: ** NEGATIVE * right end position: ** 6036335 * centisome position: ** 93.4...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] == * smiles: ** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O * inchi key: *...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-27_006560 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] ==
−
* left end position:
+
* smiles:
−
** 6029490
+
** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N
−
* right end position:
+
* common name:
−
** 6036335
+
** salicyl-6-hydroxy-2-cyclohexene-on-oyl
−
* centisome position:
+
* molecular weight:
−
** 93.48181    
+
** 262.262    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0241_0001
+
** salicyl-HCH
−
** Esi0241_0001
+
** 2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester
−
** FRD
+
** acylsaligenin
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[FUMARATE-REDUCTASE-NADH-RXN]]
+
* [[RXN-12252]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
* [[RXN-14971]]
+
−
** esiliculosus_genome
+
−
***automated-name-match
+
−
* [[RXN-15378]]
+
−
** esiliculosus_genome
+
−
***automated-name-match
+
−
* [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]]
+
−
** esiliculosus_genome
+
−
***automated-name-match
+
−
== Pathways associated ==
+
−
* [[PWY-561]]
+
−
* [[PWY-4302]]
+
−
* [[PWY-3781]]
+
−
* [[PWY0-1353]]
+
−
* [[PWY-7279]]
+
−
* [[P105-PWY]]
+
−
* [[PWY-6969]]
+
−
* [[PWY-6728]]
+
−
* [[PWY0-1329]]
+
−
* [[PWY-7254]]
+
−
* [[PWY-5690]]
+
−
* [[PWY66-398]]
+
−
* [[TCA]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=6029490}}
+
* CAS : 529507-98-0
−
{{#set: transcription direction=NEGATIVE}}
+
* PUBCHEM:
−
{{#set: right end position=6036335}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14731723 14731723]
−
{{#set: centisome position=93.48181   }}
+
{{#set: smiles=C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O}}
−
{{#set: common name=Esi_0241_0001|Esi0241_0001|FRD}}
+
{{#set: inchi key=InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N}}
−
{{#set: reaction associated=FUMARATE-REDUCTASE-NADH-RXN|RXN-14971|RXN-15378|SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN}}
+
{{#set: common name=salicyl-6-hydroxy-2-cyclohexene-on-oyl}}
−
{{#set: pathway associated=PWY-561|PWY-4302|PWY-3781|PWY0-1353|PWY-7279|P105-PWY|PWY-6969|PWY-6728|PWY0-1329|PWY-7254|PWY-5690|PWY66-398|TCA}}
+
{{#set: molecular weight=262.262   }}
 +
{{#set: common name=salicyl-HCH|2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester|acylsaligenin}}
 +
{{#set: consumed by=RXN-12252}}

Revision as of 22:55, 17 March 2018

Metabolite CPD-13174

  • smiles:
    • C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O
  • inchi key:
    • InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N
  • common name:
    • salicyl-6-hydroxy-2-cyclohexene-on-oyl
  • molecular weight:
    • 262.262
  • Synonym(s):
    • salicyl-HCH
    • 2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester
    • acylsaligenin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-21_005710&oldid=15026"