Difference between revisions of "RXN-15561"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-18_003270 == * left end position: ** 3312595 * transcription direction: ** NEGATIVE * right end position: ** 3320538 * centisome position: ** 67.2...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13713 CPD-13713] == * smiles: ** C(OP(=O)([O-])O[Se](=O)(=O)O)C1(OC(C(O)C(O)1)N3(C=NC2(C(N)...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-18_003270 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13713 CPD-13713] ==
−
* left end position:
+
* smiles:
−
** 3312595
+
** C(OP(=O)([O-])O[Se](=O)(=O)O)C1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23)))
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=XCADVMZZFPIERR-DEGSGYPDSA-M
−
* right end position:
+
* common name:
−
** 3320538
+
** adenosine 5'-phosphoselenate
−
* centisome position:
+
* molecular weight:
−
** 67.239555    
+
** 473.174    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0022_0162
+
** adenylyl-selenate
−
** Esi0022_0162
+
** APSe
 +
** adenosine phosphoselenate
 +
** adenylylselenate
 +
** adenosine-5'-phosphoselenate
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** esiliculosus_genome
+
* [[RXN-12720]]
−
***automated-name-match
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
−
* [[P562-PWY]]
+
−
* [[PWY-7241]]
+
−
* [[PWY-7237]]
+
−
* [[PWY-5940]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=3312595}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657723 90657723]
−
{{#set: right end position=3320538}}
+
* CHEBI:
−
{{#set: centisome position=67.239555   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=2485 2485]
−
{{#set: common name=Esi_0022_0162|Esi0022_0162}}
+
* LIGAND-CPD:
−
{{#set: reaction associated=MYO-INOSITOL-2-DEHYDROGENASE-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05686 C05686]
−
{{#set: pathway associated=P562-PWY|PWY-7241|PWY-7237|PWY-5940}}
+
* HMDB : HMDB04112
 +
{{#set: smiles=C(OP(=O)([O-])O[Se](=O)(=O)O)C1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23)))}}
 +
{{#set: inchi key=InChIKey=XCADVMZZFPIERR-DEGSGYPDSA-M}}
 +
{{#set: common name=adenosine 5'-phosphoselenate}}
 +
{{#set: molecular weight=473.174   }}
 +
{{#set: common name=adenylyl-selenate|APSe|adenosine phosphoselenate|adenylylselenate|adenosine-5'-phosphoselenate}}
 +
{{#set: produced by=RXN-12720}}

Revision as of 22:56, 17 March 2018

Metabolite CPD-13713

  • smiles:
    • C(OP(=O)([O-])O[Se](=O)(=O)O)C1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23)))
  • inchi key:
    • InChIKey=XCADVMZZFPIERR-DEGSGYPDSA-M
  • common name:
    • adenosine 5'-phosphoselenate
  • molecular weight:
    • 473.174
  • Synonym(s):
    • adenylyl-selenate
    • APSe
    • adenosine phosphoselenate
    • adenylylselenate
    • adenosine-5'-phosphoselenate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])O[Se](=O)(=O)O)C1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-15561&oldid=15102"