Difference between revisions of "CPD0-2472"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-00_004550 == * left end position: ** 6342458 * transcription direction: ** POSITIVE * right end position: ** 6344585 * centisome position: ** 33.4...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17624 CPD-17624] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCC(=O)[O-]...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-00_004550 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17624 CPD-17624] ==
* left end position:
+
* smiles:
** 6342458
+
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCC(=O)[O-])COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=IISWKVFHQLAOMW-BTFUZUOASA-I
* right end position:
+
* common name:
** 6344585
+
** ω-carboxy-(9Z)-octadec-9-enoyl-CoA
* centisome position:
+
* molecular weight:
** 33.47574    
+
** 1056.928    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0361_0009
+
** 18-carboxyl oleoyl-CoA
** Esi0361_0009
+
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RIBITOL-2-DEHYDROGENASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** esiliculosus_genome
+
* [[RXN-16418]]
***automated-name-match
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
* [[RIBITOLUTIL-PWY]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=6342458}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820430 91820430]
{{#set: right end position=6344585}}
+
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCC(=O)[O-])COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: centisome position=33.47574   }}
+
{{#set: inchi key=InChIKey=IISWKVFHQLAOMW-BTFUZUOASA-I}}
{{#set: common name=Esi_0361_0009|Esi0361_0009}}
+
{{#set: common name=ω-carboxy-(9Z)-octadec-9-enoyl-CoA}}
{{#set: reaction associated=RIBITOL-2-DEHYDROGENASE-RXN}}
+
{{#set: molecular weight=1056.928   }}
{{#set: pathway associated=RIBITOLUTIL-PWY}}
+
{{#set: common name=18-carboxyl oleoyl-CoA}}
 +
{{#set: produced by=RXN-16418}}

Revision as of 22:56, 17 March 2018

Metabolite CPD-17624

  • smiles:
    • CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCC(=O)[O-])COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=IISWKVFHQLAOMW-BTFUZUOASA-I
  • common name:
    • ω-carboxy-(9Z)-octadec-9-enoyl-CoA
  • molecular weight:
    • 1056.928
  • Synonym(s):
    • 18-carboxyl oleoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCC(=O)[O-])COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.