Difference between revisions of "CPD-13227"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14736 CPD-14736] == * smiles: ** C(=O)([O-])C([N+])CC(=O)C1(=C(N)C=CC=C1) * inchi key: ** I...") |
(Created page with "Category:Gene == Gene Ec-02_005310 == * left end position: ** 5575895 * transcription direction: ** NEGATIVE * right end position: ** 5584342 * centisome position: ** 85.4...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-02_005310 == |
− | * | + | * left end position: |
− | ** | + | ** 5575895 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 5584342 |
− | * | + | * centisome position: |
− | ** | + | ** 85.41780 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0024_0158 |
+ | ** Esi0024_0158 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[PHENYLALANINE--TRNA-LIGASE-RXN]] |
− | + | ** esiliculosus_genome | |
− | == | + | ***go-term |
− | * [[ | + | == Pathways associated == |
+ | * [[TRNA-CHARGING-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5575895}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=5584342}} | |
− | + | {{#set: centisome position=85.41780 }} | |
− | + | {{#set: common name=Esi_0024_0158|Esi0024_0158}} | |
− | + | {{#set: reaction associated=PHENYLALANINE--TRNA-LIGASE-RXN}} | |
− | + | {{#set: pathway associated=TRNA-CHARGING-PWY}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 21:57, 17 March 2018
Gene Ec-02_005310
- left end position:
- 5575895
- transcription direction:
- NEGATIVE
- right end position:
- 5584342
- centisome position:
- 85.41780
- Synonym(s):
- Esi_0024_0158
- Esi0024_0158
Reactions associated
- PHENYLALANINE--TRNA-LIGASE-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome