Difference between revisions of "Ec-20 001930"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADP-D-GLUCOSE ADP-D-GLUCOSE] == * smiles: ** C(C1(C(C(C(C(O1)OP(OP(OCC2(OC(C(C2O)O)N3(C4(N=CN=C...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-L-methionine-S-S-oxides Protein-L-methionine-S-S-oxides] == * common name: ** a protein...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADP-D-GLUCOSE ADP-D-GLUCOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-L-methionine-S-S-oxides Protein-L-methionine-S-S-oxides] ==
* smiles:
+
** C(C1(C(C(C(C(O1)OP(OP(OCC2(OC(C(C2O)O)N3(C4(N=CN=C(N)C(N=C3)=4))))(=O)[O-])(=O)[O-])O)O)O))O
+
* inchi key:
+
** InChIKey=WFPZSXYXPSUOPY-ROYWQJLOSA-L
+
 
* common name:
 
* common name:
** ADP-α-D-glucose
+
** a protein-L-methionine-(S)-S-oxide
* molecular weight:
+
** 587.33   
+
 
* Synonym(s):
 
* Synonym(s):
** adenosine diphosphate glucose
+
** a peptide-L-methionine-(S)-S-oxide
** ADP-glucose
+
** ADP-D-glucose
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-8668]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-761]]
 
 
== External links  ==
 
== External links  ==
* CAS : 2140-58-1
+
{{#set: common name=a protein-L-methionine-(S)-S-oxide}}
* BIGG : 35161
+
{{#set: common name=a peptide-L-methionine-(S)-S-oxide}}
* PUBCHEM:
+
{{#set: consumed by=RXN-8668}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=42609821 42609821]
+
* HMDB : HMDB06557
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00498 C00498]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57498 57498]
+
* METABOLIGHTS : MTBLC57498
+
{{#set: smiles=C(C1(C(C(C(C(O1)OP(OP(OCC2(OC(C(C2O)O)N3(C4(N=CN=C(N)C(N=C3)=4))))(=O)[O-])(=O)[O-])O)O)O))O}}
+
{{#set: inchi key=InChIKey=WFPZSXYXPSUOPY-ROYWQJLOSA-L}}
+
{{#set: common name=ADP-α-D-glucose}}
+
{{#set: molecular weight=587.33    }}
+
{{#set: common name=adenosine diphosphate glucose|ADP-glucose|ADP-D-glucose}}
+
{{#set: consumed or produced by=RXN-761}}
+

Revision as of 22:00, 17 March 2018

Metabolite Protein-L-methionine-S-S-oxides

  • common name:
    • a protein-L-methionine-(S)-S-oxide
  • Synonym(s):
    • a peptide-L-methionine-(S)-S-oxide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links