Difference between revisions of "Charged-ILE-tRNAs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11521 CPD-11521] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13378 CPD-13378] == * smiles: ** C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13378 CPD-13378] == |
* smiles: | * smiles: | ||
− | ** | + | ** C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC6(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)OC5(C(C(C(C(O5)CO)O)O)O)))6)OC7(C(O)C(O)C(O)OC(CO)7))))C(O)C(O)C(O)8))O9)O)O)O) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=GSCHIGXDTVYEEM-MIGIYTHBSA-N |
* common name: | * common name: | ||
− | ** | + | ** XLLG xyloglucan oligosaccharide |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 1387.215 |
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-12400]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940189 52940189] |
− | {{#set: smiles= | + | {{#set: smiles=C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC6(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)OC5(C(C(C(C(O5)CO)O)O)O)))6)OC7(C(O)C(O)C(O)OC(CO)7))))C(O)C(O)C(O)8))O9)O)O)O)}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=GSCHIGXDTVYEEM-MIGIYTHBSA-N}} |
− | {{#set: common name= | + | {{#set: common name=XLLG xyloglucan oligosaccharide}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=1387.215 }} |
− | {{#set: consumed by=RXN- | + | {{#set: consumed by=RXN-12400}} |
Revision as of 22:00, 17 March 2018
Contents
Metabolite CPD-13378
- smiles:
- C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC6(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)OC5(C(C(C(C(O5)CO)O)O)O)))6)OC7(C(O)C(O)C(O)OC(CO)7))))C(O)C(O)C(O)8))O9)O)O)O)
- inchi key:
- InChIKey=GSCHIGXDTVYEEM-MIGIYTHBSA-N
- common name:
- XLLG xyloglucan oligosaccharide
- molecular weight:
- 1387.215
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM: