Difference between revisions of "RXN1G-445"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-445 RXN1G-445] == * direction: ** LEFT-TO-RIGHT * common name: ** Thiolase-like, subgroup **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AN-ALPHA-L-FUCOSIDE AN-ALPHA-L-FUCOSIDE] == * smiles: ** CC1(OC(O[R])C(O)C(O)C(O)1) * common na...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AN-ALPHA-L-FUCOSIDE AN-ALPHA-L-FUCOSIDE] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC1(OC(O[R])C(O)C(O)C(O)1) |
* common name: | * common name: | ||
| − | ** | + | ** α-L-fucoside |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | * [[ALPHA-L-FUCOSIDASE-RXN]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * LIGAND-CPD: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02475 C02475] | |
| − | + | * CHEBI: | |
| − | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28349 28349] | |
| − | {{#set: | + | {{#set: smiles=CC1(OC(O[R])C(O)C(O)C(O)1)}} |
| − | {{#set: | + | {{#set: common name=α-L-fucoside}} |
| − | {{#set: | + | {{#set: consumed by=ALPHA-L-FUCOSIDASE-RXN}} |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
Revision as of 22:01, 17 March 2018
Contents
Metabolite AN-ALPHA-L-FUCOSIDE
- smiles:
- CC1(OC(O[R])C(O)C(O)C(O)1)
- common name:
- α-L-fucoside
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(OC(O[R])C(O)C(O)C(O)1)" cannot be used as a page name in this wiki.
