Difference between revisions of "Ec-28 003470"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SPERMINE SPERMINE] == * smiles: ** C(CCC[N+]CCC[N+])[N+]CCC[N+] * inchi key: ** InChIKey=PFNFFQ...") |
(Created page with "Category:Gene == Gene Ec-27_005310 == * left end position: ** 4802685 * transcription direction: ** NEGATIVE * right end position: ** 4825664 * centisome position: ** 74.4...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-27_005310 == |
− | * | + | * left end position: |
− | ** | + | ** 4802685 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 4825664 |
− | * | + | * centisome position: |
− | ** | + | ** 74.4613 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0000_0226 |
− | ** | + | ** Esi0000_0226 |
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * [[ATPASE-RXN]] | |
− | * [[ | + | ** esiliculosus_genome |
− | == | + | ***go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4802685}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=4825664}} | |
− | + | {{#set: centisome position=74.4613 }} | |
− | + | {{#set: common name=Esi_0000_0226|Esi0000_0226}} | |
− | + | {{#set: reaction associated=ATPASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 22:02, 17 March 2018
Gene Ec-27_005310
- left end position:
- 4802685
- transcription direction:
- NEGATIVE
- right end position:
- 4825664
- centisome position:
- 74.4613
- Synonym(s):
- Esi_0000_0226
- Esi0000_0226
Reactions associated
- ATPASE-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome