Difference between revisions of "NN-DIMETHYLANILINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-03_004860 == * left end position: ** 5777504 * transcription direction: ** POSITIVE * right end position: ** 5791703 * centisome position: ** 88.4...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-AMP PHOSPHORIBOSYL-AMP] == * smiles: ** C(C4(C(C(C(N3(C(C2(=C(N(C1(C(C(C(O1)COP(...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-03_004860 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-AMP PHOSPHORIBOSYL-AMP] ==
* left end position:
+
* smiles:
** 5777504
+
** C(C4(C(C(C(N3(C(C2(=C(N(C1(C(C(C(O1)COP([O-])(=O)[O-])O)O))C=N2)N=C3))=N))O4)O)O))OP([O-])([O-])=O
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=RTQMRTSPTLIIHM-KEOHHSTQSA-J
* right end position:
+
* common name:
** 5791703
+
** 1-(5-phospho-β-D-ribosyl)-AMP
* centisome position:
+
* molecular weight:
** 88.49448    
+
** 555.288    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0050_0076
+
** 1-(5-phosphoribosyl)-AMP
** Esi0050_0076
+
** phosphoribosyl-AMP
 +
** 5-phosphoribosyl-AMP
 +
** N-(5-phospho-D-ribosyl)-AMP
 +
** N-(5'-phospho-D-ribosyl)-AMP
 +
** N1-(5-phospho-D-ribosyl)-AMP
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[ATPASE-RXN]]
+
* [[HISTCYCLOHYD-RXN]]
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
***go-term
+
* [[HISTPRATPHYD-RXN]]
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** esiliculosus_genome
+
***go-term
+
* [[RXN-12195]]
+
** esiliculosus_genome
+
***go-term
+
* [[RXN-12196]]
+
** esiliculosus_genome
+
***go-term
+
* [[RXN0-5462]]
+
** esiliculosus_genome
+
***go-term
+
== Pathways associated ==
+
* [[PWY-7184]]
+
* [[PWY-7198]]
+
* [[PWY-6545]]
+
* [[PWY-7210]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=5777504}}
+
* LIGAND-CPD:
{{#set: transcription direction=POSITIVE}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C02741 C02741]
{{#set: right end position=5791703}}
+
* CHEBI:
{{#set: centisome position=88.49448   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59457 59457]
{{#set: common name=Esi_0050_0076|Esi0050_0076}}
+
* BIGG : 42711
{{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}}
+
* PUBCHEM:
{{#set: pathway associated=PWY-7184|PWY-7198|PWY-6545|PWY-7210}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45480652 45480652]
 +
* HMDB : HMDB12276
 +
{{#set: smiles=C(C4(C(C(C(N3(C(C2(=C(N(C1(C(C(C(O1)COP([O-])(=O)[O-])O)O))C=N2)N=C3))=N))O4)O)O))OP([O-])([O-])=O}}
 +
{{#set: inchi key=InChIKey=RTQMRTSPTLIIHM-KEOHHSTQSA-J}}
 +
{{#set: common name=1-(5-phospho-β-D-ribosyl)-AMP}}
 +
{{#set: molecular weight=555.288   }}
 +
{{#set: common name=1-(5-phosphoribosyl)-AMP|phosphoribosyl-AMP|5-phosphoribosyl-AMP|N-(5-phospho-D-ribosyl)-AMP|N-(5'-phospho-D-ribosyl)-AMP|N1-(5-phospho-D-ribosyl)-AMP}}
 +
{{#set: consumed by=HISTCYCLOHYD-RXN}}
 +
{{#set: produced by=HISTPRATPHYD-RXN}}

Revision as of 23:02, 17 March 2018

Metabolite PHOSPHORIBOSYL-AMP

  • smiles:
    • C(C4(C(C(C(N3(C(C2(=C(N(C1(C(C(C(O1)COP([O-])(=O)[O-])O)O))C=N2)N=C3))=N))O4)O)O))OP([O-])([O-])=O
  • inchi key:
    • InChIKey=RTQMRTSPTLIIHM-KEOHHSTQSA-J
  • common name:
    • 1-(5-phospho-β-D-ribosyl)-AMP
  • molecular weight:
    • 555.288
  • Synonym(s):
    • 1-(5-phosphoribosyl)-AMP
    • phosphoribosyl-AMP
    • 5-phosphoribosyl-AMP
    • N-(5-phospho-D-ribosyl)-AMP
    • N-(5'-phospho-D-ribosyl)-AMP
    • N1-(5-phospho-D-ribosyl)-AMP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C4(C(C(C(N3(C(C2(=C(N(C1(C(C(C(O1)COP([O-])(=O)[O-])O)O))C=N2)N=C3))=N))O4)O)O))OP([O-])([O-])=O" cannot be used as a page name in this wiki.