Difference between revisions of "THMPT"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-07_005310 == * left end position: ** 5155640 * transcription direction: ** POSITIVE * right end position: ** 5167457 * centisome position: ** 66.7...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-707 CPD-707] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-07_005310 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-707 CPD-707] ==
−
* left end position:
+
* smiles:
−
** 5155640
+
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=SGNBVLSWZMBQTH-PODYLUTMSA-N
−
* right end position:
+
* common name:
−
** 5167457
+
** campesterol
−
* centisome position:
+
* molecular weight:
−
** 66.76189    
+
** 400.687    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0176_0036
+
** cholest 5-en-3-ol, 24-methyl
−
** Esi0176_0036
+
** ergost-5-en-3β-ol, (24R)-
−
** xynA
+
** (24R)-24-methylcholest-5-en-3β-ol
 +
** 24(R)-methylcholesterol
 +
** campesterin
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[3.2.1.8-RXN]]
+
* [[RXN-4225]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
−
* [[PWY-6784]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=5155640}}
+
* LIPID_MAPS : LMST01030097
−
{{#set: transcription direction=POSITIVE}}
+
* PUBCHEM:
−
{{#set: right end position=5167457}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23424736 23424736]
−
{{#set: centisome position=66.76189   }}
+
* HMDB : HMDB02869
−
{{#set: common name=Esi_0176_0036|Esi0176_0036|xynA}}
+
* LIGAND-CPD:
−
{{#set: reaction associated=3.2.1.8-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01789 C01789]
−
{{#set: pathway associated=PWY-6784}}
+
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.10469749.html 10469749]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28623 28623]
 +
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: inchi key=InChIKey=SGNBVLSWZMBQTH-PODYLUTMSA-N}}
 +
{{#set: common name=campesterol}}
 +
{{#set: molecular weight=400.687   }}
 +
{{#set: common name=cholest 5-en-3-ol, 24-methyl|ergost-5-en-3β-ol, (24R)-|(24R)-24-methylcholest-5-en-3β-ol|24(R)-methylcholesterol|campesterin}}
 +
{{#set: consumed by=RXN-4225}}

Revision as of 23:02, 17 March 2018

Metabolite CPD-707

  • smiles:
    • CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=SGNBVLSWZMBQTH-PODYLUTMSA-N
  • common name:
    • campesterol
  • molecular weight:
    • 400.687
  • Synonym(s):
    • cholest 5-en-3-ol, 24-methyl
    • ergost-5-en-3β-ol, (24R)-
    • (24R)-24-methylcholest-5-en-3β-ol
    • 24(R)-methylcholesterol
    • campesterin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=THMPT&oldid=15528"