Difference between revisions of "TRNA-uridine-38-40"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-07_001830 == * left end position: ** 1984710 * transcription direction: ** NEGATIVE * right end position: ** 1993227 * centisome position: ** 25.7...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7005 CPD-7005] == * smiles: ** C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7005 CPD-7005] == |
− | * | + | * smiles: |
− | ** | + | ** C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(N=1)=C7([C-](C(OC)=O)C(=O)C6(C(C)=C4(N([Mg]N(C2=CC3(C(C)=C(CC)C(N=3)=C4))5)C=67)))))) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=QBLSEPRESQJTCI-ZNLWZYPOSA-M |
− | * | + | * common name: |
− | ** | + | ** geranylgeranyl chlorophyll a |
− | * | + | * molecular weight: |
− | ** | + | ** 886.447 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** geranylgeranyl-chl a |
− | ** | + | ** GG-chl a |
+ | ** GG-chlorophyll a | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-7664]] |
− | * | + | * [[RXN-17428]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657538 90657538] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64668 64668] |
− | {{#set: common name= | + | {{#set: smiles=C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(N=1)=C7([C-](C(OC)=O)C(=O)C6(C(C)=C4(N([Mg]N(C2=CC3(C(C)=C(CC)C(N=3)=C4))5)C=67))))))}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=QBLSEPRESQJTCI-ZNLWZYPOSA-M}} |
+ | {{#set: common name=geranylgeranyl chlorophyll a}} | ||
+ | {{#set: molecular weight=886.447 }} | ||
+ | {{#set: common name=geranylgeranyl-chl a|GG-chl a|GG-chlorophyll a}} | ||
+ | {{#set: consumed by=RXN-7664|RXN-17428}} |
Revision as of 23:04, 17 March 2018
Contents
Metabolite CPD-7005
- smiles:
- C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(N=1)=C7([C-](C(OC)=O)C(=O)C6(C(C)=C4(N([Mg]N(C2=CC3(C(C)=C(CC)C(N=3)=C4))5)C=67))))))
- inchi key:
- InChIKey=QBLSEPRESQJTCI-ZNLWZYPOSA-M
- common name:
- geranylgeranyl chlorophyll a
- molecular weight:
- 886.447
- Synonym(s):
- geranylgeranyl-chl a
- GG-chl a
- GG-chlorophyll a
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(N=1)=C7([C-](C(OC)=O)C(=O)C6(C(C)=C4(N([Mg]N(C2=CC3(C(C)=C(CC)C(N=3)=C4))5)C=67))))))" cannot be used as a page name in this wiki.