Difference between revisions of "CPD-13754"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-01_007190 == * left end position: ** 6140234 * transcription direction: ** POSITIVE * right end position: ** 6157420 * centisome position: ** 59.5...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14596 CPD-14596] == * smiles: ** CCC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-01_007190 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14596 CPD-14596] ==
−
* left end position:
+
* smiles:
−
** 6140234
+
** CCC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=WOSYVGNDRYBQCQ-BARGLTKPSA-N
−
* right end position:
+
* common name:
−
** 6157420
+
** neolinustatin
−
* centisome position:
+
* molecular weight:
−
** 59.505116    
+
** 423.416    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0002_0198
+
** butanenitrile
−
** Esi0002_0198
+
** [(2R)-2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylbutyronitrile)]
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[ATPASE-RXN]]
+
* [[RXN-13603]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***go-term
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=6140234}}
+
* LIGAND-CPD:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C08336 C08336]
−
{{#set: right end position=6157420}}
+
* CHEBI:
−
{{#set: centisome position=59.505116   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=7506 7506]
−
{{#set: common name=Esi_0002_0198|Esi0002_0198}}
+
* PUBCHEM:
−
{{#set: reaction associated=ATPASE-RXN}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=119533 119533]
 +
* HMDB : HMDB38482
 +
{{#set: smiles=CCC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C}}
 +
{{#set: inchi key=InChIKey=WOSYVGNDRYBQCQ-BARGLTKPSA-N}}
 +
{{#set: common name=neolinustatin}}
 +
{{#set: molecular weight=423.416   }}
 +
{{#set: common name=butanenitrile|[(2R)-2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylbutyronitrile)]}}
 +
{{#set: consumed by=RXN-13603}}

Revision as of 23:04, 17 March 2018

Metabolite CPD-14596

  • smiles:
    • CCC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C
  • inchi key:
    • InChIKey=WOSYVGNDRYBQCQ-BARGLTKPSA-N
  • common name:
    • neolinustatin
  • molecular weight:
    • 423.416
  • Synonym(s):
    • butanenitrile
    • [(2R)-2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylbutyronitrile)]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-13754&oldid=15677"