Difference between revisions of "Ec-24 000110"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIMP DIMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23))) * inchi ke...") |
(Created page with "Category:Gene == Gene Ec-13_002640 == * left end position: ** 4337969 * transcription direction: ** POSITIVE * right end position: ** 4344624 * centisome position: ** 62.5...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-13_002640 == |
− | * | + | * left end position: |
− | ** | + | ** 4337969 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4344624 |
− | * | + | * centisome position: |
− | ** | + | ** 62.5404 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0330_0020 |
− | ** | + | ** Esi0330_0020 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * [[4.2.2.10-RXN]] | |
− | * [[ | + | ** esiliculosus_genome |
− | == | + | ***automated-name-match |
+ | * [[RXN-14897]] | ||
+ | ** esiliculosus_genome | ||
+ | ***automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7243]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4337969}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=4344624}} | |
− | + | {{#set: centisome position=62.5404 }} | |
− | + | {{#set: common name=Esi_0330_0020|Esi0330_0020}} | |
− | + | {{#set: reaction associated=4.2.2.10-RXN|RXN-14897}} | |
− | + | {{#set: pathway associated=PWY-7243}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 23:04, 17 March 2018
Gene Ec-13_002640
- left end position:
- 4337969
- transcription direction:
- POSITIVE
- right end position:
- 4344624
- centisome position:
- 62.5404
- Synonym(s):
- Esi_0330_0020
- Esi0330_0020
Reactions associated
- 4.2.2.10-RXN
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome
- RXN-14897
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome