Difference between revisions of "Ec-24 001300"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZENE-NO2 BENZENE-NO2] == * smiles: ** C1(=CC=C(C=C1)[N+]([O-])=O) * inchi key: ** InChIKey=L...") |
(Created page with "Category:Gene == Gene Ec-13_001950 == * left end position: ** 3262383 * transcription direction: ** NEGATIVE * right end position: ** 3314585 * centisome position: ** 47.0...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-13_001950 == |
− | * | + | * left end position: |
− | ** | + | ** 3262383 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3314585 |
− | * | + | * centisome position: |
− | ** | + | ** 47.0337 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0068_0067 |
− | ** | + | ** Esi0068_0067 |
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * [[3-ISOPROPYLMALISOM-RXN]] |
− | + | ** [[pantograph]]-[[aragem]] | |
− | == | + | * [[HOMOACONITATE-HYDRATASE-RXN]] |
+ | ** esiliculosus_genome | ||
+ | ***ec-number | ||
+ | * [[RXN-13722]] | ||
+ | ** esiliculosus_genome | ||
+ | ***ec-number | ||
+ | * [[RXN-8991]] | ||
+ | ** [[pantograph]]-[[aragem]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-3081]] | ||
+ | * [[LYSINE-AMINOAD-PWY]] | ||
+ | * [[P241-PWY]] | ||
+ | * [[LEUSYN-PWY]] | ||
+ | * [[PWY-6871]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3262383}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=3314585}} | |
− | + | {{#set: centisome position=47.0337 }} | |
− | + | {{#set: common name=Esi_0068_0067|Esi0068_0067}} | |
− | + | {{#set: reaction associated=3-ISOPROPYLMALISOM-RXN|HOMOACONITATE-HYDRATASE-RXN|RXN-13722|RXN-8991}} | |
− | + | {{#set: pathway associated=PWY-3081|LYSINE-AMINOAD-PWY|P241-PWY|LEUSYN-PWY|PWY-6871}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 22:04, 17 March 2018
Gene Ec-13_001950
- left end position:
- 3262383
- transcription direction:
- NEGATIVE
- right end position:
- 3314585
- centisome position:
- 47.0337
- Synonym(s):
- Esi_0068_0067
- Esi0068_0067
Reactions associated
- 3-ISOPROPYLMALISOM-RXN
- HOMOACONITATE-HYDRATASE-RXN
- esiliculosus_genome
- ec-number
- esiliculosus_genome
- RXN-13722
- esiliculosus_genome
- ec-number
- esiliculosus_genome
- RXN-8991