Difference between revisions of "CPD-13014"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-23_002110 == * left end position: ** 2182018 * transcription direction: ** POSITIVE * right end position: ** 2192284 * centisome position: ** 45.0...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LYS LYS] == * smiles: ** C([N+])CCCC([N+])C([O-])=O * inchi key: ** InChIKey=KDXKERNSBIXSRK-YFK...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LYS LYS] == |
| − | * | + | * smiles: |
| − | ** | + | ** C([N+])CCCC([N+])C([O-])=O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=KDXKERNSBIXSRK-YFKPBYRVSA-O |
| − | * | + | * common name: |
| − | ** | + | ** L-lysine |
| − | * | + | * molecular weight: |
| − | ** | + | ** 147.197 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** K |
| − | ** | + | ** lysine |
| + | ** L-lys | ||
| + | ** lys | ||
| + | ** 2,6-diaminohexanoic acid | ||
| + | ** lysine acid | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-1961]] |
| − | * | + | * [[LYSINE--TRNA-LIGASE-RXN]] |
| − | * | + | * [[biomass_rxn]] |
| − | * [[ | + | * [[1.5.1.8-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[DIAMINOPIMDECARB-RXN]] |
| − | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 56-87-1 |
| − | {{#set: | + | * BIGG : 33655 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460926 5460926] |
| − | {{#set: common name= | + | * HMDB : HMDB00182 |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00047 C00047] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32551 32551] | ||
| + | * METABOLIGHTS : MTBLC32551 | ||
| + | {{#set: smiles=C([N+])CCCC([N+])C([O-])=O}} | ||
| + | {{#set: inchi key=InChIKey=KDXKERNSBIXSRK-YFKPBYRVSA-O}} | ||
| + | {{#set: common name=L-lysine}} | ||
| + | {{#set: molecular weight=147.197 }} | ||
| + | {{#set: common name=K|lysine|L-lys|lys|2,6-diaminohexanoic acid|lysine acid}} | ||
| + | {{#set: consumed by=RXN-1961|LYSINE--TRNA-LIGASE-RXN|biomass_rxn|1.5.1.8-RXN}} | ||
| + | {{#set: produced by=DIAMINOPIMDECARB-RXN}} | ||
Revision as of 23:04, 17 March 2018
Contents
Metabolite LYS
- smiles:
- C([N+])CCCC([N+])C([O-])=O
- inchi key:
- InChIKey=KDXKERNSBIXSRK-YFKPBYRVSA-O
- common name:
- L-lysine
- molecular weight:
- 147.197
- Synonym(s):
- K
- lysine
- L-lys
- lys
- 2,6-diaminohexanoic acid
- lysine acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 56-87-1
- BIGG : 33655
- PUBCHEM:
- HMDB : HMDB00182
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC32551
"C([N+])CCCC([N+])C([O-])=O" cannot be used as a page name in this wiki.
