Difference between revisions of "CPD-2750"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-00_009240 == * left end position: ** 15231882 * transcription direction: ** POSITIVE * right end position: ** 15243543 * centisome position: ** 80...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY] == * smiles: ** CC(C...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-00_009240 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY] ==
−
* left end position:
+
* smiles:
−
** 15231882
+
** CC(C)C(NC(=O)C(NC(=O)CCCC([N+])C(=O)[O-])CS)C(=O)[O-]
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=BYEIJZFKOAXBBV-QXEWZRGKSA-M
−
* right end position:
+
* common name:
−
** 15243543
+
** N-[(5S)-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine
−
* centisome position:
+
* molecular weight:
−
** 80.394455    
+
** 362.42    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0676_0005
+
** ACV
−
** Esi0676_0005
+
** L-δ-(α-aminoadipoyl)-L-cysteinyl-D-valine
 +
** δ(L-2-aminoadipyl)-L-cysteinyl-D-valine
 +
** N-[L-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[ADENYL-KIN-RXN]]
+
* [[1.21.3.1-RXN]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***go-term
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
−
* [[PWY-7219]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=15231882}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820470 91820470]
−
{{#set: right end position=15243543}}
+
* CHEBI:
−
{{#set: centisome position=80.394455   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58572 58572]
−
{{#set: common name=Esi_0676_0005|Esi0676_0005}}
+
* LIGAND-CPD:
−
{{#set: reaction associated=ADENYL-KIN-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05556 C05556]
−
{{#set: pathway associated=PWY-7219}}
+
{{#set: smiles=CC(C)C(NC(=O)C(NC(=O)CCCC([N+])C(=O)[O-])CS)C(=O)[O-]}}
 +
{{#set: inchi key=InChIKey=BYEIJZFKOAXBBV-QXEWZRGKSA-M}}
 +
{{#set: common name=N-[(5S)-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine}}
 +
{{#set: molecular weight=362.42   }}
 +
{{#set: common name=ACV|L-δ-(α-aminoadipoyl)-L-cysteinyl-D-valine|δ(L-2-aminoadipyl)-L-cysteinyl-D-valine|N-[L-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine}}
 +
{{#set: consumed by=1.21.3.1-RXN}}

Revision as of 22:05, 17 March 2018

Metabolite N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY

  • smiles:
    • CC(C)C(NC(=O)C(NC(=O)CCCC([N+])C(=O)[O-])CS)C(=O)[O-]
  • inchi key:
    • InChIKey=BYEIJZFKOAXBBV-QXEWZRGKSA-M
  • common name:
    • N-[(5S)-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine
  • molecular weight:
    • 362.42
  • Synonym(s):
    • ACV
    • L-δ-(α-aminoadipoyl)-L-cysteinyl-D-valine
    • δ(L-2-aminoadipyl)-L-cysteinyl-D-valine
    • N-[L-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(NC(=O)C(NC(=O)CCCC([N+])C(=O)[O-])CS)C(=O)[O-" cannot be used as a page name in this wiki.
"N-[(5S)-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine" cannot be used as a page name in this wiki.
"N-[L-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-2750&oldid=15755"